|
|
| Line 1: |
Line 1: |
| ==Job Power list==
| |
| Power list: [[Accelerated Development]] (Training and Battle: Physical Stats, Abilities), [[Non-Physical Interaction]] (Can interact with other angels and damage ghosts), [[Weapon Mastery]] (Of Daggers, Swords, Rapiers, Spears, Axes, Clubs, Scythes, Flails, Rods, Grimoires, Staves, Whips, Gun, Rapiers, Fans, Plates, Abacuses, Ninja Katanas, Sickles, Bows, Whips, Boomerangs, Shield, Cards, Kitchen Knives, Knight Swords, Magic Swords, Fists, and Great Swords), [[Transformation]] (Can transform into various power-up such as Hero of Justice. Can stop numerous of these transformations), [[Healing]], [[Martial Arts]], [[Chi Manipulation]], [[Energy Manipulation]], [[Stealth Mastery]], [[Magic]], [[Sound Manipulation]], [[Necromancy]], [[Summoning]], [[Animal Manipulation]] (Manipulation of mythical creatures), [[Social Influencing]] (With many Talk, Signing, and Dancing abilities, he can dramatically change his opponents mindsets from his conversions to the level where many would be willing to join his party despite trying to fight him earlier in battle), [[Creation]] (Has the abilities to create items out of thin air by refining objects into mysterious alchemical tools. Items such attack items can be made on the fly with alchemy skills), [[Pressure Points]], [[Elemental Manipulation]] ([[Fire Manipulation]], [[Hellfire Manipulation]], [[Ice Manipulation]], [[Electricity Manipulation]], [[Air Manipulation]], [[Water Manipulation]], [[Holy Manipulation]], [[Light Manipulation]], [[Darkness Manipulation]]), [[Sleep Manipulation]], [[Poison Manipulation]], [[Statistics Amplification]] (Can increase his or his ally’s statistics for the length of a battle; can passively get stronger at lower health), [[Statistics Reduction]] (Can removed his opponent's statistics increases), [[Status Effect Inducement]] (Can inflict various status effect such as blind and [[Paralysis Inducement|paralysis]]), [[Time Manipulation]] (Can slow, speed up, [[Time Stop|stop time]]; can warp space-time, and can age people until they fossilize), [[Teleportation]], [[Spatial Manipulation]] (Can twists spacetime to drop a comet on a foe; can break spacetime with skills like Darkness Seal Formation to slay foe), [[Aura]], [[Absorption]] (Can absorb the target's health, magic, and energy with With many abilities and skills such as Drain Strike, Mana Drain Strike, Spellblade Drain, Lancet among others. Can absorb elemental damages with abilities like Armor of Truth; with abilities like White Sun, can absorb all physical damages), [[Mind Manipulation]], [[Death Manipulation]], [[Vibration Manipulation]] (With attacks such as Super Vibro Blade)[[Petrification]] (With Godfather skill and Godlen needle reversal), [[Resurrection]] (Can resurrect others. Can also resurrect self with abilities like Second Coming), [[Gravity Manipulation]], [[Explosion Manipulation]] (With Makinas; Can force nuclear reactions to occur and cause nuclear explosions), [[Void Manipulation]] (With skills like Page 99999 of Chaos, he conjure the chaos and brings the end to life with a grimoire page. Chaos erase beings from existence), [[Self-Destruction]] (With abilities and skills like Saint's Self-Destruction), [[Life Manipulation]] (With Drain Skrike: Normal attack heals the user for 50% the damage done to opponent), [[Soul Manipulation]] (Via ascension and many holy skills, can send one’s soul to Heaven), [[Size Manipulation]] (Can cause opponents to become extremly small), [[Durability Negation]] (Have many skills that ignore durability like Cursed God Slash), [[Attack Reflection]] and [[Forcefield Creation]] (From skills like those from Spellsword, Spear Skills, and others. Attack reflection with skills like Carbuncle that can reflect magical attacks. He can reflect magic on his own), [[Damage Reduction]] (With skills and abilities like Great defense. Can passive reduce damage taken at lower health. Has skills and abilities that reduce reduce damage), [[Biological Manipulation]] (Can affect biology of opponents from many skills and abilities. Can also turn opponent into Zombie from many skills and abilities), [[Transmutation]] (Can transform matter into objects through alchemy), [[Vibration Manipulation]] (with Vibro Blade), [[Radiation Manipulation]] (With skills like Super-Heating Radiation), [[Weapon Creation]] (Can Created with Golden Alchemist's abilities), [[Illusion Creation]] (With Doppelganger), [[Plasma Manipulation]] (Gigavolt mage and master scholar skill: Promestein downgrade), [[Resistance Negation]] (Can weaken target's resistance), [[Berserk Mode]], improve [[Spatial Manipulation]] (With attacks like Ice Age which can freezes space itself), [[Invulnerability]] (Can temporarily become invincible with some skills and abilities that nullifies all form of damages; can become completely invincible with gem equipments)
| |
| ----
| |
| [[Resistance]] to [[Size Manipulation]], [[Poison Manipulation]], [[Sound Manipulation]], [[Sound Manipulation]], [[Corrosion Inducement]], [[Power Nullification]], [[Earth Manipulation]], [[Fire Manipulation]], [[Electricity Manipulation]], [[Ice Manipulation]]. [[Petrification]], [[Time Manipulation]], [[Status Effect Inducement]] (Can resist various status effect such as blind, stuns, and [[Paralysis Inducement|paralysis]]), [[Sleep Manipulation]], [[Mind Manipulation]] (Resists the confusion and trance status effect. Unaffected by [[Tamamo (Monster Girl Quest!)|Tamamo]]'s country-wide charm aura), [[Death Manipulation]], [[Statistics Reduction]], [[Soul Manipulation]] (Immune to the ascension status effect), [[Void Manipulation]] (Can resist Monster Lord's Cruelty, the passive void manipulation of other Apoptosis and the attack Necrosis), [[BFR]] (Resists Rezone, a skill that warps the opponent through space in order to kill them), [[Transmutation]] (Can survive long-time exposure to Chaos and Apoptosis, which would normally transform beings into Apoptosis), [[Radiation Manipulation]] (Can survive skills like Super-Heating Radiation with no negative long-term effects)
| |
| ----
| |
| Weapons: Daggers, Swords, Rapiers, Spears, Axes, Clubs, Scythes, Flails, Rods, Grimoires, Staves, Whips, Gun, Rapiers, Fans, Plates, Abacuses, Ninja Katanas, Sickles, Bows, Whips, Boomerangs, Shield, Cards, Kitchen Knives, Knight Swords, Magic Swords, Fists, Great Swords,
| |
|
| |
|
| Equipment: Armor, Heavy Armor, Helmets, Heavy Helmets, Shields, Heavy Shields, Robes, and Magic Hats
| |
| ----
| |
| =Gems Powers=
| |
| With Gems: [[Invulnerability]], Passive [[Absorption]] and [[Attack Reflection]], [[Instinctive Reaction]], [[Probability Manipulation]] (With Critical Perfection and Critical Perfection Gem)
| |
|
| |
| Gems:
| |
| * Gem: Perfect SP Regen: [Gem] Regenerate 100% of Max SP per turn.
| |
| * Gem: Quintuple SP Charge: [Gem] Quintuples SP gain when guarding or attacking.
| |
| * Gem: Ultimate Medicine: [Gem] User's healing items restore 400% more HP/MP/SP when used in combat.
| |
| * Gem: Ultimate Metabolism: [Gem] Healing items/effects used on you restore 400% more HP/MP/SP.
| |
| * Gem: Perfect MP Regen: [Gem] Regenerate 100% of Max MP per turn.
| |
| * Gem: Perfect HP Regen: [Gem] Regenerate 100% of Max HP per turn.
| |
| * Gem: Nullify All Status: [Gem] Become immune to all status effects.
| |
| * Gem: Nullify All Instant Death: [Gem] Become immune to Instant Death, Ascension, and Climax.
| |
| * Gem: Nullify Debuff: [Gem] Become immune to attempts to debuff stats.
| |
| * Gem: Nullify Elemental: [Gem] Nullify all incoming elemental damage except Holy and Dark.
| |
| * Gem: Absorb Elemental: [Gem] Absorb all incoming elemental damage except Holy and Dark.
| |
| * Gem: Reflect Elemental: [Gem] Reflect all incoming elemental damage except Holy and Dark.
| |
| * Gem: Nullify Dark: [Gem] Nullify Dark damage taken.
| |
| * Gem: Absorb Dark: [Gem] Absorb Dark damage taken.
| |
| * Gem: Reflect Dark: [Gem] Reflect incoming Dark damage.
| |
| * Gem: Nullify Holy: [Gem] Nullify Holy damage taken.
| |
| * Gem: Absorb Holy: [Gem] Absorb Holy damage taken.
| |
| * Gem: Reflect Holy: [Gem] Reflect incoming Holy damage.
| |
| * Gem: Nullify Pleasure: [Gem] Nullify Pleasure damage taken.
| |
| * Gem: Absorb Pleasure: [Gem] Absorb Pleasure damage taken.
| |
| * Gem: Reflect Pleasure: [Gem] Reflect incoming Pleasure damage.
| |
| * Gem: Nullify Physical: [Gem] Nullify Pleasure damage taken.
| |
| * Gem: Absorb Physical: [Gem] Absorb Pleasure damage taken.
| |
| * Gem: Reflect Physical: [Gem] Reflect incoming Pleasure damage.
| |
| * Gem: Ultra Endure: [Gem] While above 10% HP, survive a fatal blow with 1 HP once per battle.
| |
| * Gem: Perfect Magic Reflect: [Gem] Reflect all magic attacks.
| |
| * Gem: Untouchable: [Gem] Avoid all physical and magical attacks.
| |
| * Gem: Peerless Magic Evasion: [Gem] Avoid all magical attacks.
| |
| * Gem: Peerless Physical Evasion: [Gem] Avoid all physical attacks.
| |
| * Gem: Full Counter: [Gem] Always counter physical attacks.
| |
| * Gem: Full Magic Counter: [Gem] Always counter magical attacks.
| |
| * Gem: Absolute Omni-Counter: [Gem] Always counter all attacks.
| |
| * Gem: Critical Perfection: [Gem] Always execute critical hits.
| |
| * Gem: Perfect Hits: [Gem] Attacks always hit.
| |
| * Gem: Guard Defense *10: [Gem] Take 1/20 damage while defending instead of 1/2.
| |
|
| |
| =Jobs=
| |
| ==Part 1 Jobs==
| |
| ===Warrior===
| |
| * '''Double Slash:''' Slash a foe twice in a single attack
| |
| * '''Gale Thrust:''' Thurst a blade into a foe with the seed of a gale that has a wind attribute
| |
| * '''Power Charge''': Focus your power, +100% Attack following turn
| |
| * '''Shockwave Blade:''' Unleash a shockwave at a foe with spinning slashes
| |
| * '''Double-Edged Cut:''' A powerful attack that also sacrifices 1/3 of the user's max health.
| |
| * '''Falcon Slash:''' Slash a foe twice in a single attack.
| |
|
| |
| ===Martial Artist===
| |
| * '''Leg Sweep:''' sweep a foe's legs and disrupt their stance.
| |
| * '''Flying Knee Kick:''' Jum and strike with your knee, dealing large damage to Harpy foes.
| |
| * '''Roundhouse:''' Perform a spinning leap and kick as you turn.
| |
| * '''Focused Mind:''' Focus your mind, +25% Attack/Agility and +50% Crit Up.
| |
| * '''Steel Body:''' Stiffen your body, gain +50% Defense, and halves physical damage for 4 turns
| |
| * '''Pressure Point:''' Strike an enemy's vital point, can bring instant death.
| |
| * '''Fist Thrust:''' A strong jab, simple, but very powerful.
| |
|
| |
| ===Magician===
| |
| * Fire: Novice fire magic that burns a foe to cinders.
| |
| * Blizzard: Novice ice magic that freezes a foe solid.
| |
| * Thunder: Novice lightning magic that drops a blot to a foe.
| |
| *Poison: Magic that poisons foes. It targets all foes.
| |
| * Blind: Magic that blinds foes. It targets all foes.
| |
| * Resist Silence: Nullify attempts to inflict Silence 50% of the time.
| |
| * Mega Fire: Fire magic that burns foes to cinders. It targets all foes.
| |
| * Mega Blizzard: Ice magic that freezes a foe solid. It targets all foes.
| |
| * Mega Thunder: Lightning magic that drops a blot to foes. It targets all foes.
| |
| * Silence: Magic that silences foes. It targets all foes.
| |
| * Magic Charge: Focus your magic, +150% Magic/Willpower and +200% Hit following turn.
| |
|
| |
| ===Priest===
| |
| *Heal: Recover an ally's physical strength.
| |
| *Enhance Magic: Boost an ally's magic by +50% Magic for 6 turns.
| |
| *Enhance Mind: half magic damage an ally takes and boost their willpower by +50% Magic for 6 turns.
| |
| *Cure: Cleanse an ally of common status effects.
| |
| *Raise: Resurrect a defeated ally at 50% HP.
| |
| *Mass Heal: Recover the physical strength of oneself and allies.
| |
| *Enhance Technique: Boost an ally's dexterity by +50% Magic for 5 turns.
| |
| *Enhance Attack: Boost an ally's attack by +50% Magic for 6 turns.
| |
| *Enhance Guard: Halves physical damage an ally takes and their defense by 50% for 6 turns.
| |
| *Dispel: Remove positive effects from a foe.
| |
|
| |
| ===Hunter===
| |
| * Rapid Fire: Shoot two arrows at once at a foe.
| |
| * Beast Killer: Hunter attack that deals large damages to Beast.
| |
| * Mental Concentration: Sharpen your mind, +150% Dexterity, and +200% Hit for the following turn.
| |
| * Land-Dweller Killer: Hunter attack that deals large damage to Beasts.
| |
| * Fire Arrow: Shoot a flaming arrow at a foe.
| |
| * Ice Arrow: Shoot a frozen arrow at a foe.
| |
| * Lightning Arrow: Shoot an electrified arrow at a foe.
| |
| * Recruit Rate +150%: Sets the party's chance to recruit enemy monsters to 150% of normal.
| |
| * Chaos Arrow: Blindly fire arrows at foes. It targets 4 random does.
| |
|
| |
| ===Thief===
| |
| *Steal: Steal an item from a foe.
| |
| *Knife Throw: Throw a knife at a foe.
| |
| *Escape: Escape from normal battles 100% of the time
| |
| *Steal rate +150%: Stealing has a 150% success rate.
| |
| *Nullify Ambush: Nullify ambushes from foes.
| |
| *Rapid Knife Throw: Throw multiple knives at a foe in rapid succession.
| |
|
| |
| ===Guard===
| |
| *Armor Break: Special attacks that lower a foe's defense by 90% for 6 rounds.
| |
| *Mind Break: Special attacks that lower a foe's willpower by 90% for 6 rounds.
| |
| *Secure Hold: Tie a foe up with rope, restricting their movements.
| |
| *Speed Break: Special attacks that lower a foe's agility down by 34% for 6 turns.
| |
| *Technique Break: Special attacks that lower a foe's dexterity down by 25% for 5 turns.
| |
| *Magic Break: Special attacks that lower a foe's magic down by 34% for 6 turns.
| |
| *Power Break: Special attacks that lower a foe's attack down by 25% for 5 turns.
| |
| *Request Reinforcements: Call for reinforcements that attack for 3 rounds.
| |
|
| |
| ===Merchant===
| |
| *Buy Herb: Buy a herb and use it immediately. Effect: 50 HP Recovery
| |
| *Buy Antidote Grass: By an antidote grass and use it immediately.
| |
| *Buy Eyedrops: Buy some eyedrops and use them immediately. Effect: Cure Blind.
| |
| *Buy Full Moon Grass: Buy a Full Moon Grass and use it immediately. Effect: Cure Paralysis.
| |
| *Throw Gold: Throw gold at foes to inflict damage. Target: All Foes.
| |
| *Rescue Request: Pay gold to escape from a dungeon.
| |
| *Buy Phoenix Tail: By a Phoenix Tail and use it immediately. Effect: Revive (20% HP).
| |
| *Medicine Lore I: User's healing items restored 50% more HP/MP/SP when used in combat.
| |
| *Wagon: Pay gold to travel to previously visited locations in a fashion to teleportation.
| |
| *Buy Echo Grass: Buy an Echo Grass and use it immediately. Effect: Cure Silence
| |
| *Buy Restorative: Buy a Restorative and use it immediately. Effect: Cure Sleep/Confusion.
| |
| *Life Insurance: Party gains gold on the user's death.
| |
| *Buy Miracle Drug: Buy a Miracle Drug and use it immediately. Effect: 30 MP Recovery.
| |
| *Product Delivery: By a random item. Effect: Item Acquisition
| |
|
| |
| ===Fortune Teller===
| |
| * Tarot of Fate: Draw a random card, producing a variety of effects.
| |
| * Card Throw: Throw a card at a foe.
| |
| *Lucky Star: Target: Random Ally or Foe, Effect: All Stats/Eva/Mag Eva/Hit/Crit +50% for 6 turns.
| |
| * Last Oracle: The user gives the party an item on death.
| |
| * Gift from Heaven: Effect: Item Acquisition (Acquire a random item.)
| |
| * Oracle of the Goddess: Effect: Random (Divine message from the goddess, creating a random skill.)
| |
|
| |
| ===Gadabout===
| |
| * Dance Invitation: Distract a foe by inviting them to dance.
| |
| * Lucky Song: Double battle experience for allies with a song of happiness.
| |
|
| |
| ===Scholar===
| |
| *Combustive Reaction: A fire reaction that can damage many enemies at once.
| |
| *Freezing Reaction: An ice reaction that can damage many enemies at once.
| |
| *Electric Reaction: An electric reaction that can damage many enemies at once.
| |
| *Resist Bio 75%: Reduce Bio damage taken to 75% of normal.
| |
| *Resist Sonic 75%: Reduce Sonic damage taken to 50% of normal.
| |
| *Elemental Protection: Temporarily protects the user from fire, ice and lightning attacks.
| |
| *SP Conversion: Takes a bit of the mana of the user to convert it into SP.
| |
| *Chemical Protection: Temporarily protects the user from most status effects.
| |
| *Conversion: Takes a bit of the SP of the user to convert it into MP.
| |
|
| |
| ===Engineer===
| |
| *Auto Crossbow: Makina crossbow with a rapid-fire mechanism.
| |
| *Bio Blast: Makina that sprays poison gas on foes.
| |
| *Blast Voice: Makina that produces a destructive sound wave.
| |
| *Dual Cannon: Large cannon that fires an armor-piercing shell.
| |
| *Ocean Anchor: Makina that fires an anchor that destroys ocean monster monsters.
| |
| *Stinger: Makina that fires a surface to air missile that destroys flying monsters.
| |
| *Flamethrower: Makina that spews fire on foes.
| |
| *Electric Flux Emitter: Makina that radiates electricity on foes.
| |
|
| |
| ===Spiritualist===
| |
| *Biting Annie: Summon and control hungry zombie Biting Annie.
| |
| *Possessive Diana: Summon and control Possessive Diana.
| |
| *Slicing Elise: Summon and control wind-up doll Slicing Elise.
| |
| *Dual Slice: Slice a foe twice with a scythe.
| |
| *Mental Concentration: Sharpen your mind, +150% Dexterity, +200% Hit following turn
| |
| *Drain Strike: Normal attack heals the user for 50% the damage done.
| |
|
| |
| ===Informant===
| |
| *Talk: Invite a foe to a friendly chat.
| |
| *Provoke: Provoke a foe, lowering their affinity a little.
| |
| *Interesting Story: Distract foes by telling them an interesting story.
| |
| *Erotic Story: Arouse foes with an erotic story.
| |
| *Twin Shot: Throw a boomerang so it hits a foe twice.
| |
| *Scary Story: Paralyze foes with fear with a scary story.
| |
| *Lame Pun: chill foe with a horrible joke.
| |
| *Praise: Praise a foe, increasing their affinity a little,
| |
|
| |
| ===Cook===
| |
| *Fried Egg: The user cooks a fried egg, dealing basic damage.
| |
| *Rice Ball: The user cooks a rice ball, dealing fire damage.
| |
| *Sandwich: Make a sandwich, freezing a foe.
| |
| *Vegetable Stir Fry: The user cooks a sandwich, dealing ice damage.
| |
| *Metabolism Up: Healing items/effects used on you restore 100% more HP/MP/SP.
| |
| *Hamburger Steak: The user cooks some hamburger steak, augmenting the crit rate of all allies.
| |
| *Broiled Fish: The user cooks a broiled fish, augmenting the hit rate of all allies.
| |
| *Miso Soup: The user cooks a miso soup, augmenting the evasion rate of all allies.
| |
| *Kitty Rice: The user cooks a bowl of kitty rice, augmenting the magic evasion rate of all allies.
| |
| *Hamburger: The user cooks a hamburger, healing an ally.
| |
| *Hot Dog: The user cooks a hot dog, augmenting the attack of an ally.
| |
| *Salad: The user cooks a salad, augmenting the defense of an ally.
| |
| *Fruit Salad: The user cooks a fruit salad, augmenting the speed of an ally.
| |
| *Resist Digestion: Nullify attempts to inflict Digestion 50% of the time.
| |
| *Curry and Rice: The user cooks some curry and rice, augmenting the magical strength of an ally.
| |
| *Pizza: The user cooks a pizza, augmenting the magical defense of an ally.
| |
| *Cream Stew: The user cooks a cream stew, augmenting the dexterity of an ally.
| |
| *Spaghetti: The user cooks some spaghetti, augmenting the build-up of fighting spirit of an ally.
| |
| *Sashimi: The user cooks some sashimi, granting an ally regeneration.
| |
| *Yakitori: Cook some yakitori, grants SP regen to allies for 10 rounds.
| |
| *Soba: The user cooks some soba, granting an ally fighting spirit regeneration.
| |
| *Ingredient Collection: The user steals some cooking ingredients from the enemy.
| |
| *Croquette: The user cooks a croquette, dealing basic damage to all enemies.
| |
| *Tempura: The user cooks some tempura, dealing fire damage to all enemies.
| |
| *Omurice: The user cooks some omurice, dealing ice damage to all enemies.
| |
| *Tomato Soup: The user cooks a tomato soup, dealing electricity damage to all enemies.
| |
|
| |
| ===Nurse===
| |
| *First Aid: Heal an ally with first aid.
| |
| *Scalpel Throw: Throw a scalpel at a foe.
| |
| *Emergency Recovery: Fully heal an ally with expert surgical skills.
| |
| *Play Doctor: Give pleasure to a foe with sexy palpation.
| |
| *Metabolic Activation: Activate allies' metabolism, granting HP regen for 10 rounds.
| |
| *Magical Activation: Activate allies' magical energy, granting MP regen for 10 rounds.
| |
| *Forced Urination: Promote incontinence with expert manipulation.
| |
| *Group Therapy: Heal allies with first aid.
| |
| *Doping: Boost an ally's max HP by 50% for 5 rounds.
| |
|
| |
| ===Maid===
| |
| *Serve Tea: Heal an ally and restore their energy with special tea.
| |
| *Ecstasy Massage: Lead a foe to ecstasy with a sweet massage.
| |
| *Resist earth 50%: Reduce Earth damage taken to 75% of normal.
| |
| *Insecticide Spray: Lead a foe to incontinence with a sweet massage.
| |
| *Maid's Pruning: Prune branches, destroying plants. More effective in plant monsters.
| |
| *Duster Dance: Swing a duster around and blind a foe with a dust cloud.
| |
| *Kitchen Garden Harvest: Harvest ingredients from a kitchen garden. Target: User. Effect:+800 Speed, Acquire Food
| |
|
| |
| ===Noble===
| |
| *Charge Ray: Magnificent strike in the shape of a V.
| |
| *Dancing Saber: Thrust multiple times with elegant footwork.
| |
| *Splash Fleuret: Skillful thrusts that use elegant footwork to strike all foes at once. Effect:Recover 1 SP,+20% Hit
| |
| *HP Regen 5%: Regenerate 5% of Max HP per turn.
| |
| *Noblesse Oblige: For 4 rounds, only Rapier skills may be used, but they will execute twice.
| |
| *Experience +150%: Gain 150% XP.
| |
| *V Slash: Magnificent strike in the shape of a V. Effect: Recover 1 SP,+20% Hit. Effect:Recover 1 SP,Noblesse Oblige,SP Regen
| |
|
| |
| ===Apprentice Hero===
| |
| * '''Flail Wildy:''' Throw your weapon at random, incredibly inaccurate.
| |
| * '''Edging:''' Lose 80% of your current HP to gain +50% Crit for 4 rounds.
| |
| * '''Slave to Pleasure:''' Gain +50% XP, but take +100% Pleasure damage.
| |
| * '''Flaming Decapitation:''' Add the power of flame to an attack of the user's own creation.
| |
| * '''Goddess' Protection''' Once per battle, revive at 20% HP when defeated.
| |
| * '''SP Regen 5%:''' Regenerate 5% of Max SP per turn.
| |
| * '''Burn! Spinning Decapitation:''' Imbue flame in your weapon and spin like a cyclone.
| |
|
| |
| ===Swordsman===
| |
| *Cyclone Blade: Slash unleashes a violent gale!
| |
| *Dead Crash: Slash with all your might in an attempt to instantly slay a foe.
| |
| *Focused Spirit: Focus your energy, +200% Attack for the following turn.
| |
| *Moonlight Blade: A rapid slash that reflects light like the moon.
| |
| *Cursed God Slash: A slash that ignores the foe's defense, but has a 50% chance to miss.
| |
| *Cross Slash: Slash a foe twice in the shape of a cross.
| |
|
| |
| ===Temple Knight===
| |
| * '''Holy Spear Guard:''' Raise a holy spear to heaven to form a barrier. Halve physical damage taken and boost Defense by 50% for 6 rounds.
| |
| * '''Holy Shift:''' Thrust a spear imbued with holy power at a foe.
| |
| * '''Holy Spear Prayer:''' Raise a holy spear to heaven, restoring an ally's HP.
| |
| * '''Great Defense:''' Double the damage reduction rate of defense
| |
| * '''Spiral Fire:''' bathe a spear in flame and thrust several times at a foe.
| |
|
| |
| ===Spellsword===
| |
| * '''Spellblade Fire:''' Add fire damage to your attacks and deal +50% fire damage for 10 rounds.
| |
| * '''Spellblade Blizzard:''' Add ice damage to your attacks and deal +50% ice damage for 10 rounds.
| |
| * '''Spellblade Thunder:''' Add lightning damage to your attacks and deal +50% lightning damage for 10 rounds.
| |
| * '''Critical Auto Barrier:''' When falling below 20% HP, halve magical damage taken for 4 rounds.
| |
| * '''Fire Slash:''' A sword slash imbued with fire magic.
| |
| * '''Ice Slash:''' A sword slash imbued with ice magic.
| |
| * '''Lightning Slash:''' A sword slash imbued with lightning magic.
| |
| * '''Spellblade Poison:''' For 10 rounds, your normal attack gains a 75% chance to poison foes.
| |
| * '''Spellblade Blind:''' For 10 rounds, your normal attack gains a 75% chance to blind foes.
| |
| * '''Spellblade Silence:''' For 10 rounds, your normal attack gains a 75% chance to silence foes.
| |
| * '''Magic Barrier:''' Surround allies with a barrier that halves magical damage taken for 4 rounds.
| |
| * '''Spellblade Drain:''' For 10 rounds, your normal attack heals you for 50% of damage dealt.
| |
| * '''Vacuum Slash:''' A slash so fast it leaves behind a vacuum.
| |
|
| |
| ===Dragon Knight===
| |
| * '''High Jump:''' When any type of Spear is equipped, deal +15% damage with normal attacks, Spear skills, and Multiweapon skills.
| |
| * '''Bird Drop:''' Leap into the air and knock flying creatures from the sky.
| |
| * '''Lancet:''' Drain a foe's HP and SP with a spear thrust.
| |
| * '''Fire Spear:''' Stab a foe from overhead with a flaming spear.
| |
| * Highwind: Strike a foe with a vacuum spear.
| |
| * '''Impact Spear:''' Leap into the air and land with a shockwave, damaging foes.
| |
| *'''Wyvern Dance:''' Jump and strike 3 times before landing.
| |
|
| |
| ===Power Fighter===
| |
| * '''Club Strike:''' Crush a foe with the weight of your club.
| |
| * '''Snake Spiral:''' Swing a flail around like a serpent's tail and strike foes.
| |
| * ''Focused Spirit:''' Focus your energy, +200% Attack for the following turn.
| |
| * '''Endure:''' Once per battle, if above 30% HP, survive a lethal blow with 1 HP.
| |
| * '''Wild Club:''' Strike a foe multiple times with rapid club blows.
| |
| * '''Chain Drive:''' Swing a flail along the ground, mowing down foes.
| |
|
| |
| ===Overpowering Fist===
| |
| * '''Chakra:''' Focus your mind, restoring half of your own HP.
| |
| * '''Rakshasa Palm:''' Strike a foe with energy concentrated in your palm.
| |
| * '''Explosive Fist:''' Rapidly punch foes multiple times.
| |
| * '''Revival:''' Use chakra points to resurrect an ally.
| |
| * '''Electric Kick:''' Strike a foe with a kick imbued with lightning.
| |
|
| |
| ===Magus Fist===
| |
| * '''Flame Dance Fist:''' Add fire damage to your normal attacks and deal +50% fire damage for 4 rounds.
| |
| * '''Ice Rebellion Fist:''' Add ice damage to your normal attacks and deal +50% ice damage for 4 rounds.
| |
| * '''Inner Focused Mind:''' Focus your mind, +50% to Attack/Agility and +100% Crit Rate for 4 rounds.
| |
| * '''Thunder God Fist:''' Add lightning damage to your normal attacks and deal +50% lightning damage for 4 rounds.
| |
| * '''Mana Strike:''' Imbue your attack with mana to boost damage.
| |
| * '''Tri Element Fist:''' Add Fire/Ice/Lightning damage to your normal attacks and deal +50% Fire/Ice/Lightning damage for 4 rounds.
| |
| * '''Inner Chakra:''' Focus your mind, restoring some of your MP.
| |
| * '''Four Spirits Fist:''' Add Fire/Wind/Earth/Water damage to your normal attacks and deal +50% Fire/Wind/Earth/Water damage for 4 rounds.
| |
|
| |
| ===Paladin===
| |
| * Saint's Prayer: Pray and heal allies.
| |
| * Deva's Palm: Focus a holy aura into your palm, destroying a foe from within.
| |
| * Saint's Protection: Pray and grant a protective barrier to allies. Halve physical and magical damage taken, and boost Defense and Willpower by 50% for 4 rounds.
| |
| * Resist Zombie: Nullify attempts to inflict Zombie 50% of the time.
| |
| * Saint's Recovery: Pray and cure most possible status ailments from allies.
| |
| * Resist Ascension: Nullify attempts to inflict Ascension 50% of the time.
| |
| * Saint's Self-Destruction: Trade your life for the power to annihilate foes.
| |
| * Grand Cross: Form a cross with holy power to destroy evil that has a 10% chance to send the opponent's soul to heaven.
| |
|
| |
| ===Battle Master===
| |
| * '''Mixed Arts:''' Strike a foe with weapon attacks and martial arts skills simultaneously.
| |
| * '''Resist Blind:''' Nullify attempts to inflict Blind 50% of the time.
| |
| * '''Armed Storm:''' A storm of blades that strikes multiple times.
| |
| * '''Second Shift:''' Sharpen your spirit, causing your normal attack to strike 4 random foes for 3 turns.
| |
| * '''Wide Smash:''' Use multiple weapons to strike all foes at once.
| |
| * '''Resist Burn:''' Nullify attempts to inflict Burn 50% of the time.
| |
| * '''Resist Freeze:''' Nullify attempts to inflict Freeze 50% of the time.
| |
| * '''Resist Shock:''' Nullify attempts to inflict Shock 50% of the time.
| |
| * '''Double Attack:''' Normal attack executes 2 times.
| |
| * '''Crazy Time:''' Martial arts and weapon strikes combine in an incredible attack.
| |
|
| |
| ===Black Mage===
| |
| * '''Drain:''' Magic that drains a foe's HP to restore your own.
| |
| * '''Nullify Silence:''' Become immune to Silence.
| |
| * '''Blaze:''' Advanced fire magic that engulfs a foe in the fires of hell.
| |
| * '''Frost:''' Advanced ice magic that freezes a foe with intense cold.
| |
| * '''Spark:''' Advanced lightning magic that pours thunderbolts on a foe.
| |
| * '''Confuse:''' Magic that confuses foes.
| |
| * '''Sleep:''' Magic that puts foes to sleep.
| |
| * '''Paralyze:''' Magic that paralyzes foes.
| |
| * '''Death:''' Magic that instantly kills a foe.
| |
| * '''Madrain:''' Magic that drains a foe's MP to restore your own.
| |
|
| |
| ===Time Mage===
| |
| * '''Slow:''' Magic that slows time down for a foe.
| |
| * '''Warp:''' Magic that warps you to previously visited locations.
| |
| * '''Teleport:''' Magic that warps you to the entrance of a dungeon.
| |
| * '''Quick:''' Magic that speeds time up for an ally.
| |
| * '''Stop:''' Magic that stops time for a foe.
| |
| * '''Resist Slow:''' Nullify attempts to inflict Slow 50% of the time.
| |
| * '''Gravity:''' Magic that crushes a foe with gravity.
| |
| * '''Fossil:''' Magic that ages a foe until they are fossilized.
| |
| * '''Resist Stop:''' Nullify attempts to inflict Stop 50% of the time.
| |
| * '''Comet:''' Magic that twists spacetime to drop a comet on a foe.
| |
|
| |
| ===Summoner===
| |
| * '''Goblin:''' Summon a Goblin to attack a foe.
| |
| * '''Lamia:''' Summon a Lamia to lash foes with a tail strike.
| |
| * '''Carbuncle:''' Summon a Carbuncle that grants allies magic reflection for 3 rounds.
| |
| * '''Scylla:''' Summon a Scylla to bind foes with tentacles.
| |
| * '''Lakshmi:''' Summon Lakshmi to fully heal allies.
| |
| * '''Dragon:''' Summon a Dragon to breathe fire on foes.
| |
| * '''Phoenix:''' Summon a Phoenix to burn foes and revive fallen allies.
| |
|
| |
| ===White Mage===
| |
| * '''Mega Heal:''' Greatly recover an ally's physical strength.
| |
| * '''Mass Cure:''' Cleanse allies of common status effects.
| |
| * '''Mass Enhance Guard:''' Boost allies' Attack by 50% for 6 turns.
| |
| * '''Mass Enhance Mind:''' Halve magical damage allies take and boost their Willpower by 50% for 6 rounds.
| |
| * '''Holy Arrow:''' Holy magic that fires a sacred arrow at a foe dealing holy damage and has 10% chance to send the foes'soul to heaven.
| |
| * '''Heaven:''' Holy spell that sends a foe to heaven.
| |
| * '''Mass Heal:''' Recover the physical strength of allies.
| |
| * '''Mega Raise:''' Resurrect a defeated ally at full health.
| |
|
| |
| ===Sage===
| |
| * '''Fire Tempest:''' Magic that unleashes a tornado of flame.
| |
| * '''Magic Curtain:''' Recover MP equal to 10% of damage taken.
| |
| * '''Blizzard Storm:''' Magic that unleashes a tornado of ice.
| |
| * '''Cross Heal:''' Causes White Magic to use Magic in place of Willpower.
| |
| * '''Thunder Hurricane:''' Magic that unleashes a tornado of lightning.
| |
| * '''MP Cost 75%''' All skills have 3/4 MP cost.
| |
| * '''Heal Typhoon''' Magic that unleashes a tornado of healing.
| |
| * '''MP Regen 1%''' Regenerate 1% of Max MP per turn.
| |
|
| |
| ===Bowmaster===
| |
| * '''Splash Arrow:''' Shoot a flurry of arrows at a foe.
| |
| * '''Insect Hunt:''' Hunter skill that deals large damage to Insects.
| |
| * '''Forest Strength:''' +20% to all stats while in the forest.
| |
| * '''Flower Hunt:''' Hunter skill that deals large damage to Plants-like lifeforms.
| |
| * '''Arrow Rain:''' Fire a volley of arrows overhead, raining them down on foes.
| |
|
| |
| ===Gunner===
| |
| * '''Double Tap:''' Fire two bullets at one foe in rapid succession.
| |
| * '''Spray & Pray:''' Empty a gun's clip by firing bullets at foes.
| |
| * '''Bird Shot:''' Fire special ammo that is effective against Harpies.
| |
| * '''Succubus Slayer Bullet:''' Fire special ammo that is highly effective against Succubi.
| |
| * '''Concentrated Fire:''' Focus heavy gunfire on a foe.
| |
| * '''Recovery Bullet:''' Fire a bullet imbued with healing magic at an ally.
| |
| * '''Shotgun:''' Fire a spread shot at a foe with enough force to stagger them.
| |
| * '''Ricochet:''' Ricochet a bullet off a wall, increasing its power.
| |
|
| |
| ===Monster Tamer===
| |
| * '''Numbing Strike:''' A whip strike that numbs the body.
| |
| * '''Soothe:''' Calm foes down using taming skills, stopping them from acting.
| |
| * '''Binding Whip:''' Coil a whip around foes, binding them.
| |
| * '''Confusing Whip:''' Whip foes in the head, confusing them.
| |
| * '''Loving Whip:''' A whip technique that enchants enemies with a love
| |
| * '''Monster Servant:''' Call a monster with your whip to attack for you.
| |
| * '''Recruit Rate +200%:''' Sets the party's chance to recruit enemy monsters to 200% of normal.
| |
| * '''Snake Tail:''' Strike foes with a whip-like a snake's tail.
| |
|
| |
| ===Master Thief===
| |
| * '''Mug:''' Normal attack also attempts to steal an item.
| |
| * '''Preemptive Strike Up:''' Increase chance of getting a preemptive strike on foes.
| |
| * '''Trick Knife:''' Slash a foe with flowing strikes.
| |
| * '''Steal HP:''' Steal a foe's HP to replenish your own.
| |
| * '''Lockpick II:''' Can unlock blue and green chests.
| |
| * '''Assassin Throw:''' Aim at a foe's vital points, life-ending technique used by assassins.
| |
| * '''Steal Rate +200%:''' Stealing has a 200% success rate.
| |
|
| |
| ===Royal Guard===
| |
| * '''Armor Impact:''' Special attack that lowers foes' Defense by 90% for 6 rounds.
| |
| * '''Mind Impact:''' Special attack that lowers foes' Willpower by 90% for 6 rounds.
| |
| * '''Speed Impact:''' Special attack that lowers foes' Agility by 34% for 6 turns.
| |
| * '''Town Strength:''' +20% to all stats while in a town.
| |
| * '''Technique Impact:''' Special attack that lowers foes' Dexterity by 25% for 5 turns.
| |
| * '''Magic Impact:''' Special attack that lowers foes' Magic by 34% for 6 turns.
| |
| * '''Power Impact:''' Special attack that lowers foes' Attack by 34% for 6 turns.
| |
|
| |
| ===Hero of Justice===
| |
| * '''Transform:''' Transform into a Hero of Justice for 4 rounds, gain +50% to all stats and gain access to Justice skills.
| |
| * '''Burning Justice Punch:''' A punch of justice imbued with fire.
| |
| * '''Resist Debuff:''' Nullify attempts to debuff stats 50% of the time.
| |
| * '''Freezing Justice Punch:''' A punch of justice imbued with ice.
| |
| * '''Strength in Solitude:''' +25% to all stats for each missing or defeated party members.
| |
| * '''Shocking Justice Punch:''' A punch of justice imbued with lightning.
| |
| * '''Hero Guts:''' Restore your own health with the power of justice.
| |
| * '''Unyielding Fighting Spirit:''' +50% to all stats while below 20% HP.
| |
| * '''Hero Dance:''' Unleash a flurry of strikes imbued with justice.
| |
|
| |
| ===Black Marketeer===
| |
| * Buy High-Quality Herb: Buy a High-Quality Herb and use it immediately.
| |
| * Super Throw Gold: Throw lots of gold at foes to inflict damage.
| |
| * Buy Lucky Mallet: Buy a Lucky Mallet and use it immediately.
| |
| * Buy Holy Water: Buy some Holy Water and use it immediately. Effect: Cure Zombie.
| |
| * Buy Gold Needle: Buy a Gold Needle and use it immediately.
| |
| * Bribe: Pay a foe to let you escape from normal battles.
| |
| * Buy Boost Drink: Buy a Boost Drink and use it immediately.
| |
| * Buy De-Love Potion: Buy a De-Love Potion and use it immediately. Effect: Cure Slimed/Horny/Trance/Seduction
| |
| * Individual Life Insurance: When you are defeated in battle, the party gains gold.
| |
| * Buy Elven Miracle Drug: Buy an Elven Miracle Drug and use it immediately.
| |
| * Black Market Product Delivery: Buy a random item.
| |
| * Buy Elixir: Buy an Elixir and use it immediately.
| |
|
| |
| ===Item User===
| |
| * Distribution: Herb: Distribute a Herb's effect among allies.
| |
| * Dilution: Herb: Dilute a Herb, granting 10% HP regen to allies for 10 rounds.
| |
| * Distribution: Antidote Grass: Distribute an Antidote Grass' effect among allies.
| |
| * Distribution: Eyedrops: Distribute some Eyedrops' effects among allies.
| |
| * Distribution: Full Moon Grass: Distribute a Full Moon Grass' effect among allies.
| |
| * Prevention: Antidote Grass: Use an Antidote Grass to grant allies immunity to Poison for 10 rounds.
| |
| * Prevention: Eyedrops: Use some Eyedrops to grant allies immunity to Blind for 10 rounds.
| |
| * Prevention: Full Moon Grass: Use a Full Moon Grass to grant allies immunity to Paralysis for 10 rounds.
| |
| * Reversal: Antidote Grass: Reverse the effects of an Antidote Grass to Poison foes.
| |
| * Reversal: Eyedrops: Reverse the effects of some Eyedrops to Blind foes.
| |
| * Reversal: Full Moon Grass: Reverse the effects of an Full Moon Grass to Paralyze foes.
| |
| * Spiral Edge: Throw a boomerang that slices through the wind to attack foes.
| |
| * Distribution: Boost Drink: Effect: 50% SP Recovery. Distribute a Boost Drink's effect among allies.
| |
| * Dilution: Boost Drink: Dilute a Boost Drink, granting 20% SP regen to allies for 10 rounds.
| |
| * Distribution: Echo Grass: Distribute an Echo Grass' effect among allies.
| |
| * Distribution: Restorative: Effect: Cure Sleep/Confusion. Distribute a Restorative's effect among allies.
| |
| * Prevention: Echo Grass: Use an Echo Grass to grant allies immunity to Silence for 10 rounds.
| |
| * Prevention: Restorative: Use a Restorative to grant allies immunity to Sleep and Confusion for 10 rounds.
| |
| * Reversal: Echo Grass: Reverse the effects of an Echo Grass to Silence foes.
| |
| * Reversal: Restorative: Effect: Cure Sleep/Confusion. Distribute a Restorative's effect among allies.
| |
| * Distribution: High-Quality Herb: Distribute a High-Quality Herb's effect among allies.
| |
| * Dilution: High-Quality Herb: Dilute a High-Quality Herb, granting 20% HP regen to allies for 10 rounds.
| |
| * Distribution: Lucky Mallet: Effect: Cure Mini. Distribute a Lucky Mallet's effect among allies.
| |
| * Distribution: Holy Water: Effect: Cure Zombie. Distribute some Holy Water's effect among allies.
| |
| * Distribution: Gold Needle: Effect: Cure Petrify. Distribute a Gold Needle's effect among allies.
| |
| * Prevention: Lucky Mallet: Effect: Mini Immunity (for 10 turns). Use a Lucky Mallet to grant allies immunity to Mini for 10 rounds.
| |
| * Prevention: Effect: Zombie Immunity (for 10 turns). Use some Holy Water to grant allies immunity to Zombie for 10 rounds.
| |
| * Prevention: Gold Needle: Effect: Petrify Immunity (for 10 turns). Use a Gold Needle to grant allies immunity to Petrify for 10 rounds.
| |
| * Reversal: Lucky Mallet: Reverse the effects of a Lucky Mallet to shrink foes.
| |
| * Reversal: Holy Water: Reverse the effects of some Holy Water to Zombify foes.
| |
| * Reversal: Gold Needle: Reverse the effects of a Gold Needle to Petrify foes.
| |
| * Distribution: Phoenix Tail: Target: All Allies, Effect: Revive (20% HP). Distribute a Phoenix Tail's effect among allies.
| |
| * Prevention: Phoenix Tail: Effect: Death/Ascension Immunity. Use a Phoenix Tail to grant allies immunity to instant defeat for 10 rounds.
| |
| * Reversal: Phoenix Tail: Reverse the effects of a Phoenix Tail to send foes to heaven.
| |
| * Distribution: Miracle Drug: Distribute a Miracle Drug's effect among allies.
| |
| * Dilution: Miracle Drug: Dilute a Miracle Drug, granting 2% MP regen to allies for 10 rounds.
| |
| * Medicine Lore II: User's healing items restore 100% more HP/MP/SP when used in combat.
| |
| * Endless Use: Fire Stone: Target: All Foes. Effect: Burn (10%). Activate a Fire Stone without consuming it.
| |
| * Endless Use: Ice Stone: Target: All Foes. Effect: Freeze(10%). Activate an Ice Stone without consuming it.
| |
| * Endless Use: Thunder Stone: Target: All Foes. Effect: Shock(10%). Activate a Thunder Stone without consuming it.
| |
|
| |
| ===Adventurer===
| |
| * Deep Breathing: Calm your mind, regenerating 10% HP/SP for 6 rounds.
| |
| * Desert Strength: +20% to all stats while in the desert.
| |
| * Cave Strength: +20% to all stats while in a cave.
| |
| * Shooting Star: Throw a boomerang with the force of a shooting star.
| |
| * Self Treatment: Give yourself first aid to cure common statuses.
| |
| * Resist Instant Death: Nullify attempts to inflict Instant Death 50% of the time.
| |
| * Environmental Damage 50%: Halves damage taken while moving in poison swamps and barriers.
| |
| * Post-Battle Rest: Regenerate 10% Max HP and 2% Max MP after each battle.
| |
| * Geyser: Spray a foe with a blast of water.
| |
|
| |
| ===Gambler===
| |
| * Slots: Create a random effect based on the results of the slots.
| |
| * Vanishing Card: Throw a card at a foe with sleight of hand.
| |
| * Coin Toss: Flip a coin, causing either the user or a foe to die (Bypasses Death resistance on user).
| |
| * Last Slot: User gives the party a high-quality item on death.
| |
| * Item Slots: Acquire a random item.
| |
| * Lucky Hunter: Double all XP, Job XP, and gold gained for the current battle.
| |
|
| |
| ===Card Battler===
| |
| * Attack Draw: Oracle Skill, Effect: Random
| |
| * Slash Card: Oracle Skill (Physical 380% Dex), Target: Foe, Effect: +
| |
| * Heal Draw: Oracle Skill, Effect: Random
| |
| * Resist Stun: Nullify attempts to inflict Stun 50% of the time.
| |
| * Support Draw: Oracle Skill, Effect: Random
| |
| * Dual Soul: User can only use Oracle skills, but they execute twice.
| |
|
| |
| ===Dancer===
| |
| * Strange Dance: Absorb a foe's mana with a special magical dance.
| |
| * Encouraging Dance: Boost Attack and Agility by 50% for 6 turns with a dance that encourages allies.
| |
| * Sexy Dance: Arouse foes with a sexy dance.
| |
| * Vacuum Fan: Attack with a vacuum formed by waving a fan.
| |
| * Curse Dance: Inflict many status effects with a malevolent dance. Target: All Foes. Effect: Poison/Blind/Silence
| |
| * Death Dance: Remove positive effects from foes with a magic dispelling dance.
| |
|
| |
| ===Minstrel===
| |
| * Song of Life: Grant allies HP regen for 10 rounds with an invigorating song.
| |
| * Song of Defense: Boost allies' Defense/Willpower by 50% and halve all damage taken for 6 rounds with a calming song.
| |
| * Hide: Become targeted half as often by foes.
| |
| * Song of Energy: Grant allies SP regen for 10 rounds with an energizing song.
| |
| * Song of Offense: Boost Attack and Magic of allies by 50% for 6 rounds with a militant song.
| |
| * Song of Magic: Grant allies MP regen for 10 rounds with an empowering song.
| |
|
| |
| ===Superstar===
| |
| * Sexy Beam: Fire a beam a foe while striking a sexy pose. Effect: Seduction
| |
| * Resist Seduction: Nullify attempts to inflict Seduction 50% of the time.
| |
| * Hustle Dance: Heal allies with adance filled with vitality.
| |
| * Sparkle: Charm foes with an idol's light. Effect: Stun/Seduction (75%)
| |
| * Seduction Strike 10%: Normal attack inflicts Seduction 10% of the time.
| |
| * Stage Time: For 4 rounds, can only use Sing and Dance skills, but you act twice per turn. Effect: Stage Time, 30% SP Regen
| |
| * Pink Typhoon: Create a storm of sex appeal to make foes fall in love with you.
| |
|
| |
| ===Magical Scholar===
| |
| * Super-Heating Radiation: Create super-heating radiation with the power of science.
| |
| * Phase Transition: Cause a phase transition with the power of science. Effect: Freeze.
| |
| * Vacuum Discharge: Cause a vacuum discharge with the power of science. Effect: Shock.
| |
| * Resist Sonic 50%: Reduce Sonic damage taken to 50% of normal.
| |
| * Resist Bio 50%: Reduce Bio damage taken to 50% of normal.
| |
| * Super SP Conversion: Convert MP into a large amount of SP.
| |
| * Super MP Conversion: Convert SP into a large amount of MP.
| |
| * Design Break: Destroy monsters created through gene manipulation.
| |
| * Silent Spring: Target: All Foes, Effect: Poison/Blind/Silence (50%). Unleash chemical weapons on foes.
| |
|
| |
| ===Alchemist (Part 1)===
| |
| * Create: Herb - Alchemy, Target: Ally, Effect: 30 HP Recovery
| |
| * Create: Fire Stone - Alchemy (Fire 300% Dex), Target: All Foes
| |
| * Create: Ice Stone - Alchemy (Ice 300% Dex), Target: All Foes
| |
| * Create: Thunder Stone - Alchemy (Lightning 300% Dex), Target: All Foes
| |
| * Create: Phoenix Tail - Alchemy, Target: Ally, Effect: Revive (20% HP)
| |
| * Create: Antidote Grass - Alchemy, Target: Ally, Effect: Cure Poison
| |
| * Create: Eyedrops - Alchemy, Target: Ally, Effect: Cure Blind
| |
| * Create: Full Moon Grass - Alchemy, Target: Ally, Effect: Cure Paralysis
| |
| * Create: Miracle Drug - Alchemy, Target: Ally, Effect: 30 MP Recovery
| |
| * Create: Echo Grass - Alchemy, Target: Ally, Effect: Cure Silence
| |
| * Create: Restorative - Alchemy, Target: Ally, Effect: Cure Sleep/Confusion
| |
| * Create: Lucky Mallet - Alchemy, Target: Ally, Effect: Cure Mini
| |
| * Create: High-Quality Herb - Alchemy, Target: Ally, Effect: 300 HP Recovery
| |
| * Create: Boost Drink - Alchemy, Target: Ally, Effect: 50% SP Recovery
| |
| * Create: Red Fire Stone - Alchemy (Fire 600% Dex), Target: All Foes
| |
| * Create: Blue Ice Stone - Alchemy (Ice 600% Dex), Target: All Foes
| |
| * Create: Yellow Thunder Stone - Alchemy (Lightning 600% Dex), Target: All Foes
| |
| * Create: Elven Miracle Drug - Alchemy, Target: Ally, Effect: 100 MP Recovery
| |
| * Create: Holy Water - Alchemy, Target: Ally, Effect: Cure Zombie
| |
| * Create: Gold Needle - Alchemy, Target: Ally, Effect: Cure Petrify
| |
| * Create: De-Love Potion - Alchemy, Target: Ally, Effect: Cure Horny/Trance/Seduction/Incontinence
| |
| * Create: Ultimate Herb - Alchemy, Target: Ally, Effect: 5000 HP Recovery
| |
| * Create: Burst Drink - Alchemy, Target: Ally, Effect: 100% SP Recovery
| |
| * Create: Panacea - Alchemy, Target: Ally, Effect: Cure Status
| |
| * Create: Divine Miracle Drug - Alchemy, Target: Ally, Effect: 500 MP Recovery
| |
| * Create: Yggdrasil Leaf - Alchemy, Target: Ally, Effect: Revive (100% HP)
| |
| * Create: Elixir - Alchemy, Target: Ally, Effect: 100% HP/MP Recovery
| |
| * Create: Blazing Red Fire Stone - Alchemy (Fire 900% Dex), Target: All Foes
| |
| * Create: Frigid Blue Ice Stone - Alchemy (Ice 900% Dex), Target: All Foes
| |
| * Create: Electric Yellow Thunder Stone - Alchemy (Lightning 900% Dex), Target: All Foes
| |
| * Create: Last Elixir - Alchemy, Target: All Allies, Effect: 100% HP/MP Recovery
| |
|
| |
| ===Magical Librarian===
| |
| * '''Page 4 of Fire:''' Conjure the fires of hell with a grimoire page.
| |
| * '''Page 8 of Ice:''' Conjure freezing ice with a grimoire page.
| |
| * '''Page 16 of Thunder:''' Summon lightning with a grimoire page.
| |
| * '''Magic Converter:''' User gains +50% Magic/Willpower, but -50% Attack/Defense.
| |
| * '''Page 12 of Paralysis:''' Paralyze foes with a grimoire page.
| |
| * '''Page 777 of Healing:''' Heal allies with a grimoire page.
| |
| * '''Page 24 of Obedience:''' Seduce foes with a grimoire page.
| |
|
| |
| ===Machinist===
| |
| * Gatling Gun: Makina that fires countless bullets with multiple rotating gun barrels.
| |
| * Vibro Blade: Makin blade that increases cutting strength by vibrating at a high frequency.
| |
| * Kalina Ann Range: Makina (Physical 580% Dex), Target: All Foes, Effect: Ghost Killer
| |
| * Trial Punisher: Heavy firearm that launches gatling crosses that destroys Vampires.
| |
| * Electromagnetic Armor: Defensive makina that creates an electromagnetic defense wall.
| |
| * Drill: Makina that pierces a foe like a rapidly rotating spear.
| |
|
| |
| ===Necromancer===
| |
| * Amazon Jane: Target: Foe, Effect: Poison. Control toxic zombie Amazon Jane.
| |
| * Resist Poison: Nullify attempts to inflict Poison 50% of the time.
| |
| * Necro Sherri: Control burning zombie Necro Sherri.
| |
| * Zombie Reaping: Effect: Zombie Killer. Slice in a wide arc to destroy zombies.
| |
| * Vicarious Clara: Target: User, Effect: 2 Layer Deflector/Nullify 2 Hits. Control guarding zombie Vicarious Clara.
| |
| * Dry Elizabeth: Summoning (Pleasure 380% Mag+Dex), Target: Foe
| |
|
| |
| ===Medium===
| |
| * Bloody Mary: Control vicious ghost Bloody Mary. Target: 3 Random Foes
| |
| * Resist Paralysis: Nullify attempts to inflict Paralysis 50% of the time.
| |
| * Spirit Mage Ellie: Effect: Freeze. Target: All Foes. Control frigid ghost Spirit Mage Ellie.
| |
| * Darkness Seal Formation: Rip apart dimensions with a magic scythe that slays ghosts.
| |
| * Ghost Priest Maria: Control compassionate ghost Ghost Priest Maria. Effect: HP Recovery
| |
|
| |
| ===Puppeteer===
| |
| * Poltergeist Doll: Call out the Karakuri doll "Shoushin doll". Target: 3 Random Foes
| |
| * Resist Petrify: Nullify attempts to inflict Petrify 50% of the time.
| |
| * Shout Marta: Control wind-up doll Shout Maria. Target: All Foes, Effect: Confusion (50%)
| |
| * Feint Zapper: Scythe Skill (Physical 440% ^ of Att,Mag), Target: Foe, Effect: Doll Killer, +
| |
| * Love Marta: Control wind-up doll Love Marta.. Summoning (Pleasure 660% Dex), Target: Foe
| |
| * Saint Maiden: Control wind-up doll Saint Maiden. Target: Foe, Effect: Bind (75%)
| |
|
| |
| ===Smooth Talker===
| |
| * '''Threaten:''' Threaten a foe into fleeing, only works during normal battles.
| |
| * '''Beg for Money:''' Beg for gold from a foe, lowering affinity.
| |
| * '''Beg for Items:''' Beg for an item from a foe, lowering affinity.
| |
| * '''Ally Invitation:''' Invite foes to become allies, tripling recruit rate for this battle.
| |
| * '''Will:''' Upon death, user boosts stats of all other allies by 50% and halves their damage taken for 5 turns.
| |
| * '''Wind Throw:''' Throw a wind-infused boomerang to attack foes.
| |
| * '''Return:''' Persuade foes to flee, only works during normal battles.
| |
| * '''Word Bomb:''' Create an explosion with the power of language.
| |
|
| |
| ===Three Star Chef===
| |
| * Gratin: Cook some gratin, shocking a foe.
| |
| * Paella: Cook some paella, freezing a foe.
| |
| * Shrimp Chili: Cook shrimp chili, burning a foe.
| |
| * Super Metabolism: Healing items/effects used on you restore 200% more HP/MP/SP.
| |
| * Takoyaki: Cook some takoyaki, slicing a foe with wind blades.
| |
| * Taiyaki: Cook some taiyaki, drenching a foe and doing water damage.
| |
| * Okonomiyaki: Cook some okonomiyaki, crushing a foe with earth.
| |
| * Nullify Digestion: Become immune to Digestion.
| |
| * Anpan: Cook some anpan, healing the user and allies.
| |
| * Chocolate Coronet: Make some chocolate coronets, boosts the user's and allies' Dexterity by 50% for 6 turns.
| |
| * Melon Bun: Make some melon buns, boosts the user's and allies' Magic by 50% for 6 turns.
| |
| * Curry Bun: Make some curry buns, boosts the user's and allies' Attack by 50% for 6 turns.
| |
| * Croquette Bun: Make some croquette buns, doubles the user's and allies' SP gain from attacking for 6 rounds.
| |
| * Steamed Meat Bun: Make some steamed meat buns, burning all foes.
| |
| * Steamed Bun: Make some steamed buns, freezing all foes.
| |
| * Pizza Bun: Make some pizza buns, shocking all foes with electricity.
| |
| * Beef Bowl: Cook a beef bowl, damaging all foes.
| |
| * Fried Rice: Cook some fried rice, slicing all foes with wind blades.
| |
| * Nabe: Cook some nabe, crushing all foes with earth.
| |
| * Oden: Cook some oden, drenching all foes and doing water damage.
| |
|
| |
| ===Doctor===
| |
| * Emergency Surgery: Cleanse standard status effects from an ally.
| |
| * Dissection: Dissect a foe mid-combat.
| |
| * Revival: Revives an ally with expert medical skill.
| |
| * Inner Metabolic Activation: Greatly activate allies' metabolism, granting HP regen for 10 rounds.
| |
| * Inner Magical Activation: Greatly activate allies' magical energy, granting MP regen for 10 rounds.
| |
| * Antibiotic Injection: Inject an ally with an antibiotic, preventing common status effects for 10 rounds.
| |
| * Shock Resistance Injection: Inject an ally or the user with medicine that prevents instant defeat effects for 10 rounds. Effect: Nullify Death/Ascension/Climax
| |
| * Doping All: Boost an ally's max HP by 50% for 5 rounds.
| |
|
| |
| ===Master Maid===
| |
| * Special Herbal Tea: Heal an ally and restore their energy with herbal tea.
| |
| * Nullify Earth: Nullify Earth damage taken.
| |
| * Resist Slimed: Nullify attempts to inflict Slimed 50% of the time.
| |
| * Swift Cleaning: Damage foes by quickly cleans the enemy with a moist cloth. Effect: Slimed (75%)
| |
| * Job XP +150%: Gain 150% Job XP.
| |
|
| |
| ===King===
| |
| * '''Sun Slice:''' Slash with a blade bathed in flame.
| |
| * '''Nullify Critical:''' Evade all critical attacks.
| |
| * '''King's Authority:''' Halve all damage taken and boost all stats by 50% for 4 turns with a king's power.
| |
| * '''Divine Kingship:''' Regen 30% HP, 8% MP, and 30% SP for 6 rounds with divine grace.
| |
| * '''HP Regen 10%:''' Regenerate 10% of Max HP per turn.
| |
| * '''King's Army:''' Call the armies of a king to assault foes.
| |
| * '''Experience +200%:''' Gain 200% XP.
| |
| * '''Royal Life Sword:''' Blade of roaring flames filled with a ruler's beliefs.
| |
|
| |
| ===Pope===
| |
| * '''Healing Grace:''' Heal and invigorate allies with a Pope's prayer.
| |
| * '''Magic Reflection +30%:''' Increase Magic Reflect rate by 30%.
| |
| * '''Second Coming:''' Through sincere prayer, gain the ability to revive yourself when defeated.
| |
| * '''13th Law: Iron Hammer:''' Destroy wickedness with holy energy.
| |
| * '''Holy Martyr:''' On death, the user fully heals and revives all party members.
| |
| * '''Experience +200%:''' Gain 200% XP.
| |
| * '''Rotary Sermon:''' Preach to foes and make them ascend to heaven.
| |
|
| |
| ===Hero===
| |
| * '''Demon Slicer:''' Hero's skill that destroys Yoma and Vampires.
| |
| * '''Undead Slicer:''' Hero's skill that destroys Zombies and Ghosts.
| |
| * '''Rising Heavenly Inferno Slash:''' Imbue flame in your weapon and strike with all your strength.
| |
| * '''Miracle of the Goddess''' Once per battle, revive at 50% HP when defeated.
| |
| * '''SP Regen 10%:''' Regenerate 10% of Max SP per turn.
| |
| * '''Red Lotus Heavenly Cyclone:''' Hero's skill to spin around and destroy foes with roaring flames.
| |
| * '''Red Lotus Flame Dance:''' Hero's skill that strikes four times with a weapon wreathed in the fire of hell.
| |
|
| |
| ==Part 2 Jobs==
| |
| ===Samurai===
| |
| * Swordslap: A sword technique that damage and stuns the enemy
| |
| * Bedroplet cut (肉斬骨断): A secret technique that throws away the defense and improves attack and dexterity.
| |
| * Three Step Decapitation: A technique to deliver three consecutive strikes.
| |
| * Critical Auto Guard: When dropping below 20% HP, halve physical damage taken for 4 rounds
| |
| * Iainuki: Once the sword is put in the sheath, stroke it with a single stroke
| |
| * Clear Mind: A secret skill that does not accept attribute damage during the three turns due to its strong mental strength. Effect: Null All Elements (For 3 Turns)
| |
| * Fang: The essential sword technique of killing using a spring of a strong body.
| |
| * Iai:Flame: A sword technique that cuts the enemy with flames.
| |
|
| |
| ===Savage Warrior===
| |
| * Volcano Axe: An axe strike with the force of a volcano.
| |
| * Berserker: Drive yourself berserk until battle ends, gain +50% Attack and regen 30% SP per turn, but become uncontrollable.
| |
| * Hurricane Swing: Form a vacuum wave with a powerful axe swing.
| |
| * Berserker: Become Berserk in battle, but boost Attack by 50% and regenerate 30% SP per turn.
| |
| * Double SP Charge: Doubles SP gain when guarding or attacking.
| |
| * Berserker Rush: Rush foes like a berserker, swinging an axe randomly.
| |
|
| |
| ===Tao Swordsman===
| |
| * Wind Soul Slash: Imbue a blade with Taoist energy, slashing with the power of wind.
| |
| * Earth Soul Slash: Imbue a blade with Taoist energy, slashing with the power of earth.
| |
| * Water Soul Slash: Imbue a blade with Taoist energy, slashing with the power of water.
| |
| * Bird Stance: Taoist stance that regenerates 10% SP and boosts evasion by 30% for 6 rounds.
| |
| * Drain Soul Slash: Imbue a blade with Taoist energy, causing your strike to drain a foe's energy.
| |
| * Death Slash: Imbue a blade with Taoist energy, causing your strike to inflict instant death.
| |
|
| |
| ===Taoist===
| |
| * Blinding Wind Talisman: Use a talisman to damage foes and make them take 50% more Wind damage for 4 rounds. Effect: Blind (75%), Wind Weak(100%),100% Hit.
| |
| * Silent Earth Talisman: Use a talisman to damage foes and make them take 50% more Earth damage for 4 rounds. Effect: Silence(75%), Earth Weak(100%),100% Hit.
| |
| * Toxic Water Talisman: Use a talisman to damage foes and make them take 50% more Water damage for 4 rounds. Effect: Poison(75%), Water Weak(100%),100% Hit.
| |
| * Resist Wind 75%: Reduce Wind damage taken to 75% of normal.
| |
| * Spirit Stance: Taoist stance that regenerates 2% MP and boosts evasion by 30% for 6 rounds.
| |
| * Resist Water 75%: Reduce Water damage taken to 75% of normal.
| |
| * Draining Light Talisman: Use a talisman to damage foes and make them take 50% more Holy damage for 4 rounds. Effect:HP Drain 50%, Ascension(10%),Holy Weak (100%), Auto-Hit.
| |
|
| |
| ===Magical Girl===
| |
| * Magical Change: Transform into a Magical Girl for 4 rounds, gain +50% to all statccs and gain access to Justice skills.
| |
| * Magical Star: Defeat evil with the magic of stars
| |
| * Resist Fire 75%: Reduce Fire damage taken to 75% of normal.
| |
| * Magical Heal: Immaculate prayer brings healing
| |
| * Resist Ice 75%: Reduce Ice damage taken to 75% of normal.
| |
| * Magical Aura: Defeat evils with the wave of life.
| |
| * Resist Lightning 75%: Reduce Lightning damage taken to 75% of normal.
| |
| * MP Regen 2%: Regenerate 2% of Max MP per turn.
| |
| * Law of Cycles: The sense of the torus leads to the rebirth of the deed that the effect of Auto Resurrection where the user is endowed with divine rebirth after death.
| |
|
| |
| ===Ninja===
| |
| * Fire Veil: Call forth flames to incinerate foes.
| |
| * Doppleganger: Create an illusory doppelganger to make foes miss more often. Gives +50% Eva for 4 rounds.
| |
| * Water Veil: Call forth a wave of water to drown foes.
| |
| * Resist Wind 50%: Reduce Wind damage taken to 50% of normal.
| |
| * Smoke Screen: Create a smoke screen to escape from normal battles 100% of the time.
| |
| * Lightning Veil: Call forth an electric current to shock foes.
| |
|
| |
| ===Pirate===
| |
| * Hack and Slash: A pirate technique that sharply cuts enemies with a blade
| |
| * Resist Water 50%: Reduce Water damage taken to 50% of normal.
| |
| * Resist Sleep: Nullify attempts to inflict Sleep 50% of the time.
| |
| * Mermaid Hunt: Highly effective attack on mermaids created by pirates
| |
| * Sea Strength: +20% to all stats while in the ocean.
| |
| * Mug: Steal items at the same time you attack.
| |
| * Support Bombardment: Requests shelling from a pirate ship and shells fall for 3 turns
| |
| * Calm Fist: A pirate-specific martial art that tears enemies with the blade of the wind
| |
| * SP Cost 75%: All skills have 3/4 SP cost.
| |
| * Bloodbath: A pirate technique that knocks down enemies with merciless assault.
| |
|
| |
| ===Marine===
| |
| * Splitting Waterfall: The sword technique that the marines have mastered, cutting the waterfall
| |
| * Resist Water 50%: Reduce Water damage taken to 50% of normal.
| |
| * Resist Confusion: Nullify attempts to inflict Confusion 50% of the time.
| |
| * Ocean Slayer: Highly effective attack on marine life created by pirates
| |
| * Sea Strength: +20% to all stats while in the ocean.
| |
| * Armada Bombardment: Shells drop from Navy's invincible fleet, lasting 5 turns
| |
| * Aqua Rend: A marine sword skill that directs the enemy to blade rain.
| |
| * Battle Start SP Up: Start battles with 75% Max SP instead of 50%.
| |
| * Marine Dance: A marine sword skill that directs the enemy to blade rain
| |
|
| |
| ===Swordmaster===
| |
| * World Wrecking Decapitation: Desperate attack that puts the power of darkness into the blade to kill an enemy
| |
| * Darkness: Infuse darkness into your normal attack, dealing massive damage, but losing some HP.
| |
| * Dark Strike: Normal attack also deals Dark damage.
| |
| * Spellblade Dark: Add dark damage to your attacks and deal +50% dark damage for 10 rounds.
| |
| * Magic Shadow Meteor Slash (魔影流星斬): A attack of darkness that destroys enemies with a shooting storm like a meteor.
| |
| * Demon Sword Snowstorm: A attack that cuts through enemies in the falling snow that deal ice damage and can freeze a foe
| |
|
| |
| ===Holy Knight===
| |
| * Requiem Lance: A spear technique to eliminate the uncleanness and send the dark monster back to hell; it super effective against monsters like vampires, zombies, and ghosts.
| |
| * Holy Spear Charge: Raise a holy spear to inspire and increase the attack power of all allies and self.
| |
| * Sun Conquista: A holy spear technique that deals three consecutive attacks that has a chance to send the opponent's soul to heaven.
| |
| * Miraculous Holy Spear: Pray with a miracle spear in the sky and restore the HP of all allies
| |
| * Ultimate Defense: Increases the damage reduction rate of defense by 4 times.
| |
| * Sun Rebellion: The sacred secret that destroys evil by holding the power of wickedness in the spear that has a chance to send the opponent's soul to heaven.
| |
|
| |
| ===Master Swordcerer===
| |
| * Spellblade Wind: Add wind damage to your attacks and deal +50% wind damage for 10 rounds.
| |
| * Spellblade Earth: Add earth damage to your attacks and deal +50% earth damage for 10 rounds.
| |
| * Spellblade Water: Add water damage to your attacks and deal +50% water damage for 10 rounds.
| |
| * Flame Slash: Slash all foes with a blade infused with fire magic.
| |
| * Ice Slash: A sword slash imbued with ice magic that has a chance to freeze a foe.
| |
| * Thunder Slash: A sword slash imbued with lightning magic.
| |
| * Spellblade Paralysis: For 10 rounds, your normal attack gains a 100% chance to paralyze foes.
| |
| * Spellblade Confusion: For 10 rounds, your normal attack gains a 100% chance to confuse foes.
| |
| * Spellblade Sleep: For 10 rounds, your normal attack gains a 100% chance to lull foes to sleep.
| |
| * Magic Reflect: Surround allies with a barrier that reflects magic for 3 rounds.
| |
| * Attack Magi: Causes Black Magic, Time Magic, Summoning skills, and Demon Arts skills to use Attack in place of Magic.
| |
| * Spellblade Death: For 10 rounds, your normal attack gains a 100% chance to slay foes.
| |
| * Giga Slash: The technique of destruction that puts the magical powers of the fire, ice, lightning attributes into the blade to attack foes.
| |
|
| |
| ===Holy Lancer===
| |
| * Lightning Spear: Penetrate the enemy from above with a spear accompanied by thunder
| |
| * Illusion Lance: Divine Profundity that sends the spear point dancing wildly and destroys the darkness which deal holy damage!
| |
| * Aqua Lance: Quickly pierce the enemy with a spear filled with the power of water dealing water damage,
| |
| * Empty Spear: Causes Spear skills to use Agility in place of Attack.
| |
| * Holy Landing: The profundity that soars high into the heavens and descends a holy spear towards the earth dealing holy damage to foes and has a chance of sending their souls to heaven!
| |
| * Godly Dragon Spear: A skill that absorbs the enemy's HP and MP, SP with a spear with holy magic!
| |
| * Holy Spear Dance: Attack with 4 consecutive thrusts with holy wave motion that has a chance of sending their souls to heaven.
| |
|
| |
| ===Dark Dragon Knight===
| |
| * Nightmare Lance: 4 consecutive thrusts with a wave of darkness that has a chance to kill foes.
| |
| * Ice Shattering Lance: A spear with ice will pierce the enemy from overhead and has a chance to freeze foes.
| |
| * Raging Quake Spear: A spear with the power of the earth to cut the enemy in two
| |
| * Forceful Spear: Causes Spear skills to use Attack in place of Agility.
| |
| * Darkness Drive: A technique that runs through the sky and draws a dark magic circle, involving all the enemies in the wave of destruction that has a chance to kill foes.
| |
| * Wicked Dragon Spear: Absorbs the enemy's HP and SP, killing them instantly at the same time with a dark spear move!
| |
| * Dark Spear Dance: 4 consecutive thrusts with a wave of darkness that has a chance to kill foes.
| |
|
| |
| ===Samurai Saint===
| |
| * Iai: Thunder: A sword technique to slash an enemy in an iaido with lightning.
| |
| * Spirit Slaying Sword: A sword technique that strikes down a wandering soul with an unblemished white blade dealing extra damage to ghosts
| |
| * Honed Katana: Causes Katana skills to use Dexterity in place of Attack.
| |
| * Shrinkage and flame flash (縮地・焔閃): Send out a divine slash and wipe out the enemy with a fiery sword flash!
| |
| * Serene Mind: Entrust your mind to water's flow, +200% Hit & +50% Eva/Mag Eva for 4 rounds.
| |
| * Kyoka Suigetsu: The special magic of the Myeikagami-no-Sui, which can scatter the lives of enemies with flowers that deal holy damage and that has 10% chance to send the foes' soul to heaven.
| |
| * the Holy Blade of the Seven Stars (聖刃七星天): A special magic that creates countless sword flashes with holy flashes that has 10% chance to send the foes'soul to heaven.
| |
|
| |
| ===Dark Samurai===
| |
| * Iai: Blizzard: A sword technique to slash an enemy in an icy attack that also can freeze foes.
| |
| * Iainuki: An iaido technique in which the sword is sheathed and stroked to death with a single blow that is highly effective against demi-humans.
| |
| * Forceful Katana: Causes Katana skills to use Attack in place of Dexterity.
| |
| * Magic-ice funeral knife (魔氷葬送刃): With a sharp blade accompanied by ice, a slash that bury the enemy in no time that also can freeze foes.
| |
| * Kiri sute gomen (切り捨て御免): The blade is cursed with an immortal curse, and for a little while, normal attacks are accompanied by an instant death effect.
| |
| * Particle Destroying Flash (微塵滅閃: The magic of darkness that cuts through the enemy in all directions with the blade of the Grudge that has 10% chance to induce death to foes.
| |
| * Sakura Flower Genmai (桜花幻舞): A dark Iai in quick succession that has 10% chance to induce death to foes.
| |
|
| |
| ===Giga Fighter===
| |
| * Wild Full Swing: Swinging the cudgel with stiffness, it spins and attacks all foes.
| |
| * Critical Arc: Swinging the iron ball with brute force, it cleaves all foes.
| |
| * Full Power: Focus all your might, +300% Attack for the following turn.
| |
| * Super Endure: Once per battle, if above 20% HP, survive a lethal blow with 1 HP.
| |
| * Cosmic Blast: A technique which is said to destroy the stars of the galaxy.
| |
| * Uroboros: An iron ball that concentrates a barrage of blows on a single enemy.
| |
|
| |
| ===Berserker===
| |
| * Earth Rumbling Decapitation: The power of the earth resides in the axe and is used for striking with all its might.
| |
| * High Berseker: Rampage while in battle; increasing Attack by 100%, acting twice, and regenerating 50% SP per round, but become uncontrollable.
| |
| * Deadly Hawk: A technique that throws the axe like a boomerang over and over again to all foes.
| |
| * Hi-Berseker: Rampage while in battle; increasing Attack by 100%, acting twice, and regenerating 50% SP per round, but become uncontrollable.
| |
| * Triple SP Charge: Triples SP gain when guarding or attacking.
| |
| * Octo Diabolo: A technique that takes the fighting spirit to the limit and slams a barrage of axes into a crowd of enemies.
| |
|
| |
| ===Kuji-In Sword God===
| |
| * Byakko Slash: Imbue a blade with Taoist energy, slashing foes with the power of the White Tiger of wind and that make foes 50 % weaker to wind damage.
| |
| * Technical Sword: Causes Sword skills to use Dexterity in place of Attack.
| |
| * Genbu Slash: Imbue a blade with Taoist energy, slashing foes with the power of the Black Tortoise of earth and that make foes 50 % weaker to earth damage.
| |
| * Seiryuu Slash: Imbue a blade with Taoist energy, slashing foes with the power of the Blue Dragon of water and that make foes 50 % weaker to water damage.
| |
| * Dragon Stance: Taoist stance that regenerates 20% SP and boosts evasion by 50% for 6 rounds.
| |
| * Suzaku Slash: Imbue a blade with Taoist energy, slashing foes with the power of the Red Phoenix of fire and that make foes 50 % weaker to fire damage.
| |
|
| |
| ===Saint Fist===
| |
| * Light Rending Fist: Accompanied by a holy aura, it unleashes a barrage of fists on all enemies that has 10% chance to send the foes' soul to heaven.
| |
| * Quad Heaven Palm: Concentrate the sacred aura on your fists and deliver 4 consecutive shots that has 10% chance to send the foes' soul to heaven.
| |
| * Dancing Fist: Causes Unarmed skills to use Agility in place of Attack.
| |
| * Diffuse Chakra: A healing technique that diffuses healing chi and heals the entire ally
| |
| * Spirit Palm: Concentrate energy in your palm and thrust it at your foe.
| |
| * Knockout Palm: Quietly take a stance and unleash a counterattack from the bottom of the palm against the enemy's attack.
| |
|
| |
| ===Dark Fist===
| |
| * Dark Onslaught Fist: Accompanied by a dark aura, it unleashes a barrage of fists on all enemies that has 10% chance to cause death.
| |
| * Four Strike Star Destruction: Accompanied by a dark aura, it unleashes a barrage of fists on all enemies that has 10% chance to cause death.
| |
| * Heavy Fist: Causes Unarmed skills to use Attack in place of Agility.
| |
| * Darkness: Effect:Self Damage(2%),Death(10%).
| |
| Infuse darkness into your normal attack, dealing massive damage, but losing some HP.
| |
| * Spirit Palm: Concentrate energy in your palm and thrust it at your foe.
| |
| *Shun Goku Satsu: A dark aura is used to unleashes a wild attack to bury enemies.
| |
|
| |
| ===Force Monk===
| |
| * Vacuum Wave Palm: Add wind damage to your normal attacks and deal +50% wind damage for 4 rounds.
| |
| * Magic Counter 50%: Set magic counter rate to 50%.
| |
| * Backwater (裏背水): Sacrifice 90% of your current HP to recover all of your SP.
| |
| * Earth Diamond Fist: Add earth damage to your normal attacks and deal +50% earth damage for 4 rounds.
| |
| * Mana Drain Strike: Normal attack targeting foe's mind that damages and drains MP.
| |
| * Dual Energy Fist: Add Holy and Dark damage to your normal attacks and deal +50% Holy and Dark damage for 4 rounds.
| |
| * Wave Crash Kick: Add water damage to your normal attacks and deal +50% water damage for 4 rounds.
| |
| * Resuscitation (裏蘇生): A secret revitalization technique to revive allies while heal them.
| |
| * Rapid Magi: Causes Black Magic, Time Magic, Summoning skills, and Demon Arts skills to use Agility in place of Magic.
| |
| * Element Finish: A backstory that strikes a single enemy with 6 attributes (Fire/Ice/Lightning/Water/Earth/Wind) of magic.
| |
|
| |
| ===God Hand===
| |
| * Saint's Grand PrayerA healing technique that heals all allies by saint's prayer. Effect: 100% HP Recovery
| |
| * Desperate Strike: Normal attack that deals +50% damage, but makes you take double damage for the remainder of the round.
| |
| * Nullify Zombie: Become immune to Zombie.
| |
| * God's Fist: Attack's of hitting an enemy with holy power that has a chance to send the opponent's soul to heaven.
| |
| * Saint's Miracle: Techniques that bring miracles and revive allies
| |
| * Nullify Ascension: Become immune to Ascension.
| |
| * Saint's Martyrdom: Technique to recover and resurrect all allies in exchange for their own sacrifice
| |
| * Golden Hammer: The secret of turning the anger of heaven into a fist and giving a hammer that has a 10% chance to send the opponent's soul to heaven.
| |
|
| |
| ===Inferno Mage===
| |
| * Omega Blaze: Top class fire magic that engulfs foes in a whirlpool of the fires of hell.
| |
| * Fire Strike: Normal attack also deals Fire damage.
| |
| * Nullify Burn: Become immune to Burn.
| |
| * Nullify Fire: Nullify Fire damage taken.
| |
| * Prominence: Ultimate fire magic that destroys foes in a conflagration from hell.
| |
|
| |
| ===Arctic Mage===
| |
| * Sigma Frost: Top class ice magic that freezes foes with intense cold.
| |
| * Ice Strike: Normal attack also deals Ice damage.
| |
| * Nullify Freeze: Become immune to Freeze.
| |
| * Nullify Ice: Nullify Ice damage taken.
| |
| * Ice Age: Ultimate ice magic that freezes space itself.
| |
|
| |
| ===Gigavolt Mage===
| |
| * Lambda Spark: Top class lightning magic that pours thunderbolts on foes.
| |
| * Lightning Strike: Normal attack also deals Lightning damage.
| |
| * Nullify Shock: Become immune to Shock.
| |
| * Nullify Lightning: Nullify Lightning damage taken.
| |
| * Plasma Storm: Ultimate lightning magic that fills the area with lightning.
| |
|
| |
| ===Spacetime Mage===
| |
| * Mass Slow: Magic that slows time down for foes.
| |
| * Mass Quick: Effect: Quick
| |
| Magic that speeds time up for allies.
| |
| * Mass Stop: Magic that stops time for foes.
| |
| * Rezone: Magic that relocates a foe through space, killing them instantly.
| |
| * Nullify Slow: Become immune to Slow.
| |
| * Mass Gravity: Magic that crushes foes with gravity.
| |
| * Nullify Stop: Become immune to Stop.
| |
| * Meteor: Magic to distort space-time and summon giant meteorites
| |
|
| |
| ===Spirit Summoner===
| |
| * Sylph: Summon Sylph to damage foes; +50% Agi/Eva/Mag Eva, gain Windstrike, deal +50% Wind damage, & absorb Wind damage for 4 rounds.
| |
| * Gnome: Summon Gnome to damage foes; +50% Def/Crit, Null Bind, gain Earthstrike, deal +50% Earth damage, & absorb Earth damage taken for 4 rounds.
| |
| * Undine: Summon Undine to damage foes; +50% Dex/Will/Eva/Mag Eva/Crit, gain Waterstrike, deal +50% Water damage, & absorb Water damage taken for 4 rounds.
| |
| * Salamander: Summon Salamander to damage foes; +50% Atk/SP Regen, gain Firestrike, deal +50% Fire damage, & absorb Fire damage for 4 rounds.
| |
| * Reaper: Summoning magic that calls Reaper to cause death damage to foes.
| |
| * Divine Dragon: Summoning magic calling the dragon that deals holy damage that has a 10% chance to sends foes'soul to heaven.
| |
|
| |
| ===Cosmic Taoist===
| |
| * Confounding Fire Talisman: Use a talisman to damage, confuse foes and make them take 50% more Fire damage for 4 rounds.
| |
| * Nullify Wind: Nullify Wind damage taken.
| |
| * Dreaming Ice Talisman: Use a talisman to damage, freeze foes and make them take 50% more Ice damage for 4 rounds.
| |
| * Nullify Earth: Nullify Earth damage taken.
| |
| * Paralyzing Lightning Talisman: Use a talisman to damage, paralyze foes and make them take 50% more Lightning damage for 4 rounds.
| |
| * Nullify Water: Nullify Water damage taken.
| |
| * Greedy Darkness Talisman: Use a talisman to cause death damage to a foe and make them take 50% more Dark damage for 4 rounds.
| |
| * Divine Stance: Taoist stance that regenerates 4% MP and boosts evasion by 50% for 6 rounds.
| |
| * Taoism Exorcist Formation: Enter a Taoist stance, countering any magic attacks that strike you for 1 round.
| |
|
| |
| ===Holy Mage===
| |
| * Mass Enhance Magic: Boost allies' Magic by 50% for 6 turns.
| |
| * Mass Enhance Technique: Boost allies' Dexterity by 50% for 6 turns.
| |
| * Mass Enhance Attack: Boost allies' Attack by 50% for 6 turns.
| |
| * Nirvana: The magic that makes countless holy arrows rain down from the heavens that has a 10% chance to send foes soul to heaven.
| |
| * Mass Mega Raise: Resurrect all defeated allies at full health.
| |
|
| |
| ===Holy Archer===
| |
| * Lamia Buster: The hunter's blow that does a lot of damage to Lamia.
| |
| * Scylla Buster: The hunter's blow that deals massive damage to Scylla.
| |
| * Super Forest Strength: +40% to all stats while in the forest.
| |
| * Meteor Arrows: The secret of putting the power of holiness and sending arrows flying wildly like a meteor that has 10% chance to send foes soul to heaven.
| |
|
| |
| ===Shadow Hunter===
| |
| * Elf Hunting: The hunter's blow that deals massive damage to the elves.
| |
| * Fairy Hunting: The hunter's blow that deals massive damage to the fairies.
| |
| * Super Forest Strength: +40% to all stats while in the forest.
| |
| * Sanka Ranya (散華乱矢): A mystic who shoots wildly with arrows filled with the power of darkness that has 10% chance to cause death.
| |
|
| |
| ===God's Eye===
| |
| * Saint Rose: A gun technique that fires a sacred bullet and creates a flowery explosion that has 10% chance to send foes soul to heaven.
| |
| * Dancing Flare: A firearm that shoots a barrage of flaming bullets throughout the enemies.
| |
| * Silver Bullet: A gun technique that fires a bullet that is effective against vampires and yoma.
| |
| * Exorcism Bullet: A gun technique that fires a bullet that is effective against the undead like ghosts and zombies.
| |
| * Recovery Gattling: It's a barrage of bullets loaded with the power of recovery.
| |
| * Holy Desperado: Fire holy bullets wildly into a crowd of enemies that has a 10% chance to send foes soul to heaven.
| |
|
| |
| ===Devil's Eye===
| |
| * Black Dahlia: A firearm technique that fires a dark bullet and creates a flower-like explosion that has a 10% chance to cause death.
| |
| * Megiddo Burst: Firearms that shoot a barrage of ice bullets foes that 10% chance to freeze them.
| |
| * Toxic Spiral Bullet: A firearm technique that fires bullets that are effective against biological monsters like Land-Dweller and Sea-Dweller.
| |
| * Mythbuster: A gun technique that fires a bullet at a phantom beast that is super effective against mermaid, kitsune, and dragon.
| |
| * Yin-Yang: A gun technique in which a cursed bullet is fired at the target that 25% chance to cause petrification and cause death.
| |
| * Shadow Desperado: Dark bullets shoot wildly into a crowd of enemies that has 10% chance to inflict death.
| |
|
| |
| ===Dragon Tamer===
| |
| * Dragon Tail: A whipping technique that strikes the entire enemy with the force of a dragon's tail.
| |
| * Holy Servant: Wielding the whip and summoning the holy beast to attack
| |
| * Recruit Rate +300%: Sets the party's chance to recruit enemy monsters to 300% of normal.
| |
| * Serpent Dance: The whip's barrage profundity that fuses strength and suppleness and rages through a crowd of enemies.
| |
|
| |
| ===Devil Summoner===
| |
| * Devil Buster: Devil Summoner's unique whip technique that deals heavy damage to yoma and has a 25% chance to cause paralysis.
| |
| * Jet Black Snake: A whipping technique that strikes the entire enemy with an aura of darkness that has a 10% chance to cause death and a 25% chance to cause paralysis.
| |
| * Devil Servant: Used a whip to summon demons to attack.
| |
| * Recruit Rate +300%: Sets the party's chance to recruit enemy monsters to 300% of normal.
| |
| * Dark Spiral Whip: Putting a dark aura into his whip, he strikes the enemy in a spiral orbit which has a chance to inflict death and paralysis.
| |
|
| |
| ===Trickster===
| |
| * Assassin Dance: Attack the foe's vital points with dancing movements.
| |
| * Infinite Knives: Throw countless knives at a foe.
| |
| * Technical Knife: Causes Dagger skills to use Dexterity in place of Attack.
| |
| * Steal MP: Steal a foe's MP to replenish your own.
| |
| * Steal SP: Steal a foe's SP to replenish your own.
| |
| * Bandit's Proof: A blow that engraves the thief's extreme skills on the enemy which lowers all the statistics of the foe.
| |
|
| |
| ===Master Shinobi===
| |
| *Scattering Cherry Blossoms: A ninja technique that pierces the vital points of the enemy and disperses lives.
| |
| * Wind Strike: Normal attack also deals Wind damage.
| |
| *Quadruple Bluster Storm: Ninjutsu unlocks the power of nature and causes a blast of wind to damage foes and has a 10% chance to burn foes.
| |
| *Shinobi Secret technique・ Disturbed Spiral Killing (忍奥義・乱れ螺旋殺): A secret technique where one runs around the enemies and unleash a slashing attack.
| |
| *Nullify Wind: Nullify Wind damage taken.
| |
|
| |
| ===Erotic Kunoichi===
| |
| *Pleasure Strike: Normal attack also deals Pleasure damage.
| |
|
| |
| ===Pirate King===
| |
| * Oceanic Decapitation: A pirate's sword technique that cuts off enemies like a rushing wave
| |
| * Nullify Water: Nullify Water damage taken.
| |
| * Nullify Sleep: Become immune to Sleep.
| |
| * Water Strike: Normal attack also deals Water damage.
| |
| * Super Sea Strength: +40% to all stats while in the ocean.
| |
| * Kaiser Fleet: Cannonballs drop from a fleet led by the Pirate King for 5 turns
| |
| * Quinzing water (四連凪刃): The war-wrestling of the Marine Corps that generates water shocks in four consecutive succession
| |
| * SP Cost 50%: All skills have 1/2 SP cost.
| |
| * Eight-legged jump (八艘跳び): An attack of the Pirate King who jumps on the ship to shoot foes
| |
|
| |
|
| |
| ===Admiral===
| |
| * Aqua Dash: The brilliant sword technique of a naval admirer waving the blade while running on the water surface dealing water damage
| |
| * Nullify Water: Nullify Water damage taken.
| |
| * Nullify Confusion: Become immune to Confusion.
| |
| * Water Strike: Normal attack also deals Water damage.
| |
| * Super Sea Strength: +40% to all stats while in the ocean.
| |
| * Armada Bombardment: Shells drop from Navy's invincible fleet, lasting 5 turns
| |
| * Eight jumps (四鳴水破): The technique of the King of Piracy who jumped on board as if it were to dance and struck in succession
| |
| * Battle Start SP MAX: Start battles with 100% Max SP instead of 50%.
| |
| * Admiral Wild Dance: The technique of the naval general, which combines hard strength with the sharpness of the blade and stare the enemy
| |
|
| |
| ===Invisible hand of God===
| |
| * Buy Ultimate Herb: Buy an Ultimate Herb and use it immediately. Target: Ally or user, Effect: 5000 HP Recovery
| |
| * Buy Burst Drink: Buy a Burst Drink and use it immediately. Target: Ally or user Effect: 100% SP Recovery
| |
| * Final Throw Gold: Throw money at the enemies and deal damage.
| |
| * Buy Panacea: Buy a Panacea and use it immediately. Target: Ally or User, Effect: Cure Status
| |
| * Scatter Bribe: Bribe our enemies and get them to leave in peace. Target: All Foes, Effect: Flee Battle
| |
| * Buy Yggdrasil Leaf: Buy a Yggdrasil Leaf and use it immediately. Target: Ally, Effect: Revive (100% HP)
| |
| * Buy Divine Miracle Drug: Buy a Divine Miracle Drug and use it immediately. Target: Ally or user, Effect: 500 MP Recovery
| |
| * Group Life Insurance: Target: User, Effect: Gain Gold on Death
| |
| * Ultimate Delivery - Mercantile, Target: User, Effect: Item Acquisition
| |
| * Buy Last Elixir: Buy a Last Elixir and use it immediately. Target: All Allies and the user, Effect: 100% HP/MP Recovery
| |
|
| |
| ===Item Master===
| |
| * Endless Use: Wind Stone: Activate a Wind Stone without consuming it while dealing wind damage.
| |
| * Endless Use: Earth Stone - EX-Item (Earth 300% Dex), Target: All Foes, Effect: 100% Hit, No Crit
| |
| * Endless Use: Water Stone - EX-Item (Water 300% Dex), Target: All Foes, Effect: 100% Hit, No Crit
| |
| * Stargazer: A throwing technique that throws boomerangs with the power of the stars at the enemy
| |
| * Distribution:De-Love Potion - EX-Item, Target: All Allies, Effect: Cure Horny/Trance/Seduction
| |
| * Prevention:De-Love Potion - EX-Item, Target: All Allies, Effect: Horny/Trance/Seduction Immunity (for 10 turns)
| |
| * Reversal:De-Love Potion - EX-Item, Target: All Foes, Effect: Horny/Trance/Seduction (75%)
| |
| * Distribution: Elven Miracle Drug - EX-Item, Target: All Allies, Effect: 100 MP Recovery
| |
| * Dilution: Elven Miracle Drug - EX-Item, Target: All Allies, Effect: 4% MP Regen
| |
| * Distribution: Burst Drink - EX-Item, Target: All Allies, Effect: 100% SP Recovery
| |
| * Dilution: Burst Drink - EX-Item, Target: All Allies, Effect: 30% SP Regen
| |
| * Endless Use: Holy Stone - EX-Item (Holy 300% Dex), Target: All Foes, Effect: 100% Hit, No Crit
| |
| * Endless Use: Dark Stone - EX-Item (Dark 300% Dex), Target: All Foes, Effect: 100% Hit, No Crit
| |
| * Distribution: Ultimate Herb - EX-Item, Target: All Allies, Effect: 5000 HP Recovery
| |
| * Dilution: Ultimate Herb - EX-Item, Target: All Allies, Effect: 30% HP Regen
| |
| * Distribution: Panacea - EX-Item, Target: All Allies, Effect: Cure Status
| |
| * Prevention: Panacea - EX-Item, Target: All Allies, Effect: Status Immunity
| |
| * Reversal: Panacea - EX-Item, Target: All Foes, Effect: Random Status (75%)
| |
| * Distribution: Yggdrasil Leaf - EX-Item, Target: All Allies, Effect: Revive (100% HP)
| |
| * Prevention: Yggdrasil Leaf - EX-Item, Target: All Allies, Effect: Auto-Revive (100%)
| |
| * Distribution: Divine Miracle Drug - EX-Item, Target: All Allies, Effect: 500 MP Recovery
| |
| * Dilution: Divine Miracle Drug - EX-Item, Target: All Allies, Effect: 8% MP Regen
| |
| * Distribution: Elixir - EX-Item, Target: All Allies, Effect: 100% HP/MP Recovery
| |
| * Dilution: Elixir - EX-Item, Target: All Allies, Effect: HP/MP/SP Regen (30%/8%/30%)
| |
| * Medicine Lore III: User's healing items restore 200% more HP/MP/SP when used in combat.
| |
| * Dilution: Last Elixir - EX-Item, Target: All Allies, Effect: 100% HP/MP/SP Regen
| |
|
| |
| ===Ranger===
| |
| * Tactical Breathing: Practice intensive breath control, regenerating 30% HP/SP for 6 rounds.
| |
| * Super Desert Strength: +40% to all stats while in the desert.
| |
| * Super Cave Strength: +40% to all stats while in a cave.
| |
| * Aqua Splash: A mystery attack that attacks the entire enemy with the water flow released from the earth
| |
| * Preventive Self Treatment: Give yourself first aid to prevent common statuses. Effect:Status Immunity.
| |
| * Nullify Instant Death: Become immune to Instant Death.
| |
| * Nullify Environmental Damage: Nullifies damage taken while moving in poison swamps and barriers.
| |
| * Post-Battle Great Rest: Regenerate 20% Max HP and 4% Max MP after each battle.
| |
| * Cosmic Throw: Throwing technique that throws boomerang many times like a meteor
| |
|
| |
| ===Dark Gambler===
| |
| * Poker: Random tricks with different effects depending on the role of poker
| |
| * Jackpot: A gambler blow with random and drastic power
| |
| * Death Roulette: Spin roulette to kill one enemy or friend immediately
| |
| * Last Chance: User gives the party a rare item on death.
| |
| * Dark Item Slots: Acquire a random item.
| |
| * Punishment Game: Attack that can deal deadly damage to all enemies or allies.
| |
|
| |
| ===Card Summoner===
| |
| * Low Draw: random skill to draw an low summoning card from the deck
| |
| * Million Card: A technique use your cards to damage enemies
| |
| * Randomizer: Causes random state of abnormalities to the enemy. Effect: Random chance: Poison/Blind/Silence(50%),Confusion/Sleep/Paralysis(25%)
| |
| * Nullify Stun: Become immune to Stun.
| |
| * High Draw: Random skill to draw an advanced summoning card from the deck
| |
| * Berserker Soul: Can only use Oracle skills, but you act five times per turn.
| |
|
| |
| ===Godfather===
| |
| * Retribution: A gun technique whose power increases as the user's physical strength decreases
| |
| * Honor: Gun techniques that have more power when there are more uncombatable allies
| |
| * Punishment: A merciless technique that shoots allies and drives them to death
| |
| * Vengeance Strike: Deal 50% more damage for each incapacitated ally.
| |
| * Assassination: Shoot bullets at the enemy's vital point and kill immediately
| |
| * Enforcement: Gun technique that kills allies immediately.
| |
| * Evil Flower (悪の華): Gun technique which power increase as the user is damaged and allies defeated
| |
|
| |
| ===War Miko===
| |
| * Sword Dance: Dance with a sword and make countless slashes
| |
| * Falling Leaves Dance: An fan attack that makes enemies fall asleep
| |
| * Sacrifice Dance: Target: All Allies, Effect: 100% HP Recovery/Revive(100% HP),+800 Speed
| |
| * Thunder God Dance: Bringing God's lightning to bring his enemies to justice
| |
|
| |
| ===Divine Songstress===
| |
| * Cicada Song: A song that creates hollow doubles to boost allies' Evasion by 50% for 4 rounds.
| |
| * Love Song: Drown foes in bliss with a sweet melody.
| |
| * Super Hide: Become targeted 1/5 as often by foes.
| |
| * Requiem: Damage the undead with requiem for the dead
| |
| * Hero's Song: A heroic song that boosts all allies' stats by 50% and halves all damage taken for 4 rounds.
| |
| * Spirit Song: Revive allies with a song dedicated to the spirit
| |
|
| |
| ===Some Jobs===
| |
| * Nullify Horny: Become immune to Horny.
| |
| * Nullify Trance: Become immune to Trance.
| |
| * Trance Strike 20%: Normal attack inflicts Trance 10% of the time.
| |
| * Resist Horny: Nullify attempts to inflict Horny 50% of the time.
| |
| * Resist Trance: Nullify attempts to inflict Trance 50% of the time.
| |
| * Horny Strike 10%: Normal attack inflicts Horny 10% of the time.
| |
| * Trance Strike 10%: Normal attack inflicts Trance 10% of the time.
| |
| * Resist Climax: Nullify attempts to inflict Climax 50% of the time.
| |
| * Resist Incontinence: Nullify attempts to inflict Incontinence 50% of the time.
| |
| * Incontinence Strike 20%: Normal attack inflicts Incontinence 20% of the time.
| |
|
| |
| ===Master Scholar===
| |
| * Implosion: A skill that creates an implosion within the enemy.
| |
| * Nullify Bio: Nullify Bio damage taken.
| |
| * Nullify Sonic: Nullify Sonic damage taken.
| |
| * ID Destruction: Defeat special genetically modified demons
| |
| * Absolute Zero: A skill that casts absolute zero on the opponent.
| |
| * Complete SP Conversion: Completely restore the user’s SP at the cost of MP.
| |
| * Plasma: A skill that casts plasma at the opponent.
| |
| * Ultra MP Conversion: Restores a large amount of MP at the cost of SP.
| |
| * Nuclear: A nuclear explosion is created within the opponents’ body. This attack uses the Nuclear element, which bypasses all attempts at reflection and absorption, alongside ignoring all resistances and immunity to attacks.
| |
|
| |
| ===Golden Alchemist===
| |
| * Gungnir: Transmutted Gungnir out of nothing and equipped it at the same time; Then, unleash the power of Gungnir.
| |
| * Excalibur: Transmutted Excalibur out of nothing and equipped it at the same time as it fires a holy blow that damage all enemies and has a 10% chance to send the foes' soul to heaven.
| |
|
| |
| ===Library Lord===
| |
| * Page 32 of Wind: Generate a vacuum blade with the power of a magic book
| |
| * Page 1001 of Divine Protection: Boost all allies' stats by 50% and halve all damage taken for 6 rounds with a grimoire page.
| |
| * Page 64 of Earth: Generate falling rocks with the power of a magic book
| |
| * Page 128 of Water: Generate a water hammer with the power of a magic book
| |
| * Magic Reflector: +100% to Magic Reflection rate, but take +100% damage from physical sources.
| |
| * Page 888 of Miracle: Heal the whole ally with the power of a magic book
| |
| * Page 99999 of Chaos: Conjure the chaos and brings the end to life with a grimoire page.
| |
|
| |
| ===Makina Master===
| |
| * Super Vibro Blade: Makina, where the blades generate super-vibration and cut any material.
| |
| * MLRS: Powerful anti-military makina firing twin rockets dealing burning damage.
| |
| * Hyperion: A strategic makina that fires photon bullets and destroys all targets.
| |
| * Weak Matter: Special Makina that weakens all attributes. Effect: All Element Weakening.
| |
| * Eldridge: A warship of a different civilization that fires a bombardment that crosses dimensions
| |
| * Ragnarok: Ultimate destruction makina that was used in the struggle of the gods dealing fire and nuclear damage.
| |
|
| |
| ===Necromaster===
| |
| * Rotting Knight Alexia: Call the cavalry zombie "The Knight Alexia" who deal Poison damage.
| |
| * Nullify Poison: Become immune to Poison.
| |
| * Deathly Gorgeous Princess Reina: Call the cavalry zombie Glorious Necro Princess Reina"
| |
| * Bio Strike: Normal attack also deals Bio damage, and has a chance to inflict Poison.
| |
| * Darkness Flash: Attack with a Scythe deal intense damage to undead enemies like Zombie with the blade of God
| |
| * Queen Necrodia: Call the cavalry zombie "Queen Necrodia" who deal poison damage.
| |
| * Zombie Horde: Call the cavalry zombie Eliminaire.
| |
|
| |
| ===Master Shaman===
| |
| * Gozen Tomoe, Female Warrior Samurai Tomoe, Lady Tomoe: Call the ghost "Tomoe Gozen" who deals magic damage.
| |
| * Nullify Paralysis: Become immune to Paralysis.
| |
| * Great Mage Gregoria: Call the cavalry ghost "Great Mage Gregoria". Summoning (Ice 1000% Mag), Target: All Foes, Effect: 100% Hit
| |
| * Contract of Darkness: Skills that sacrifice health have 1/2 HP cost.
| |
| * Darkness Scatter: A ruthless scythe that cuts enemies with a blade of darkness and disperses them
| |
|
| |
| ===Puppet Master===
| |
| * Beck the Beast: Call out the doll "Beck the Beast"
| |
| * Nullify Petrify: Become immune to Petrify.
| |
| * Giant Sera: Call out the doll "Giant Sara"
| |
| * Sonic Strike: Normal attack also deals Sonic damage, and has a chance to inflict Confusion.
| |
| * Puppet Reaper: Skill that masters the mechanism and dismantles inorganic beings like dolls.
| |
| * Decisive Weapon Agni: Call out the doll "Kagureki Weapon Agni" who deal fire damage
| |
|
| |
| ===God of Speech===
| |
| * Major Provocation: Curse enemies and greatly reduce friendship.
| |
| * Epic Tale: Release the potential of the user and all allies with the power of words. Target: All Allies, Effect: All Stats Up (for 3 turns)
| |
| * Jinx: Spread a curse on all enemies with the power of words. Effect: Death
| |
| * Lip Service Master: User can only use Talk skills, but they have 1/2 SP cost. Also gives +30% Eva/Mag Eva.
| |
| * Burning Edge: Throwing technique that burns out all enemies with boomerang with burning fire
| |
| * Celebrate: Heal the user and all allies with the power of words
| |
| * Great Praise: Praise the enemy and greatly increase friendship
| |
|
| |
| ===Flavor Emperor===
| |
| * Sushi: Make some sushi, boosts the user and all allies' Defense by 50% and halves physical damage taken for 6 rounds.
| |
| * Mapo Tofu: Cook some mapo tofu, boosts the user and all allies' Attack by 50% for 6 rounds.
| |
| * Deep Fried Tofu: Cook some deep fried tofu, boosts the user and all allies' Willpower by 50% and halves magical damage taken for 6 rounds.
| |
| * Roast Chicken: Cook some roast chicken, boosts the user and all allies' Magic by 50% for 6 rounds.
| |
| * Ultimate Metabolism: Healing items/effects used on you restore 400% more HP/MP/SP.
| |
| * Yakisoba Bread: Cook some yakisoba bread, boosts the user and all allies' Agility by 50% for 6 rounds.
| |
| * Meat Bun: Cook some meat buns, boosts the user and all allies' Dexterity by 50% for 6 rounds.
| |
| * Egg Bagel Sandwich: Make an egg bagel sandwich, recovering the user or an ally's MP by 5%.
| |
| * Salmon Bagel Sandwich: Make a salmon bagel sandwich, recovering the user or an ally's SP by 30%.
| |
| * Chef Capriciousness: Randomly cook and have a cooking effect.
| |
| * Crab Omelet: Cook some crab omelets, burning foes.
| |
| * Ice Cream: Make some ice cream, freezing all foes with the ice attribute.
| |
| * Pudding: Make some pudding, shocking all foes with electricity.
| |
| * Parfait: Make some parfait, restoring the user and all allies' HP.
| |
| * Kids Meal: Make a children's lunch and demonstrate the culinary effect that give the user or an ally the Auto-Revive effect.
| |
| * Steak: Cook some steak, slicing all foes with wind blades.
| |
| * Deluxe Rice Ball: Make some deluxe rice balls, drenching all foes and doing water damage.
| |
| * Deluxe Sushi: Make some deluxe sushi, crushing all foes with earth damage.
| |
| * Sukiyaki: Cook some broiled eel, recovering all of the user's or an ally's SP.
| |
| * Broiled Eel: Cook some broiled eel, recovering all of the user's or an ally's SP.
| |
| * Gian Stew: Make a gyroscope stew and get a cooking effect that causes dark damage to all foes and has a 10% chance to kill all foes.
| |
| * Wedding Cake: Make a wedding cake and have a culinary effect that causes holy damage to all foes and has a 10% chance to send their soul to heaven.
| |
|
| |
| ===Godly Doctor===
| |
| * Group Surgery: Medical technology that greatly recovers the HP of friends by full-scale treatment. Effect: 100% HP Recovery
| |
| * Tafel Anatomy: Fatal medical action that kills the enemy alone
| |
| * Re-Revival Treatment: Use medical expertise to cause an ally to revive automatically if they are defeated. Effect: Auto-Revive
| |
| * Extracellular Metabolic Activation: Medicine, Target: All Allies, Effect: 30% HP Regen (for 10 turns)
| |
| * Extracellular Magical Activation: Hugely activate allies' metabolism, granting HP regen for 10 rounds. Effect:30% HP Regen
| |
| * Mass Antibiotic Injection: Inject allies with an antibiotic, preventing common status effects for 10 rounds. Effect: Nullify Status Effects (for 10 turns)
| |
| * Mass Shock Resistance Injection: Inject allies with medicine that prevents instant defeat effects for 10 rounds. Effect: Nullify Death/Ascension/Climax
| |
| * Mass Revival: Revives all allies with expert medical skill. Effect: Revive (20% HP)
| |
|
| |
| ===Grandmaster Maid===
| |
| * Forbidden Herbal Tea: Restore strength and energy with forbidden herbal teas. Effect:HP Recovery,75% SP Recovery
| |
| * Earth Strike: Normal attack also deals Earth damage.
| |
| * Nullify Slimed: Become immune to Slimed.
| |
| * Thousand Blossom Plate Toss: Damage foes by throwing countless dishes in a row
| |
|
| |
| ===Alchemist (Part 2)===
| |
| * Potion: Create a Potion and restore HP. Target: Ally, Effect: 50% HP Recovery
| |
| * Hero's Victory Cry: Unleash a triumphant shout, increasing all allies' stats by +50% and halves all damage taken for 4 rounds.
| |
| * Crash Drum: Create a Crash Drum, increasing allies' critical rate by +100% and hit rate by +200% for 6 rounds.
| |
| * Planet Light: Create a Planet Light, quantifying all XP, Job XP, and gold gained for the current battle.
| |
| * Yggdrasil Branch: Create a Yggdrasil Branch, reviving all allies. Target: All Allies, Effect: Revive (100% HP)
| |
| * Fire Sword: Infuse allies with the power of fire, add fire damage to their attacks, absorb fire, and deal +50% fire damage for 10 rounds.
| |
| *Ice Sword: Infuse allies with the power of ice, add ice damage to their attacks, absorb ice, and deal +50% ice damage for 10 rounds.
| |
| * Earth Sword: Infuse allies with the power of the earth, add Earth damage to their attacks, absorb Earth, and deal +50% Earth damage for 10 rounds.
| |
| * Ether: Create an Ether and restore MP. Effect: 33% MP Recovery
| |
| * Lightning Sword: Infuse allies with the power of lightning, add lightning damage to their attacks, absorb lightning, and deal +50% lightning damage for 10 rounds.
| |
| * Wind Sword: Infuse allies with the power of Wind, add Wind damage to their attacks, absorb Wind, and deal +50% Wind damage for 10 rounds.
| |
| * Water Sword: Infuse allies with the power of Water, add Water damage to their attacks, absorb Water, and deal +50% Water damage for 10 rounds.
| |
| * Grand Potion: Create a Grand Potion and restore HP. Target: Ally, Effect: 100% HP Recovery
| |
| * Boost: Create a Boost and restore SP completely.
| |
| * Guardian Angel Helmet: Create Guardian Angel Helmets, blocking instant defeat effects for 10 rounds. Effect: Death/Ascension/Climax Immunity 10 Turns
| |
| * White Sun: Create a White Sun, absorbing all physical damage taken for 4 rounds.
| |
| * Collapse of the Creator: The mystery of alchemy that has an overwhelming effect only on the Inorganic lifeforms.
| |
| * Grand Ether: Create a Grand Ether and restore MP., Target: Ally, Effect: 100% MP Recovery
| |
| * Holy Sword: Infuse allies with the power of Holy, add Holy damage to their attacks, absorb Holy, and deal +50% Holy damage for 10 rounds.
| |
| * Dark Sword: Infuse allies with the power of darkness, add Dark damage to their attacks, absorb Dark, and deal +50% Dark damage for 10 rounds.
| |
| * Gale Shoes: Create pairs of Gale Shoes, boosting allies' Evasion by +75% for 4 rounds.
| |
| * Last Potion: Create a Last Potion and restore HP., Effect: 100% HP Recovery
| |
| * Last Boost: Create a Last Boost and restore SP.
| |
| * Wonder Ruby: Create a Wonder Ruby, boosting allies' Magic Evasion by +75% for 4 rounds.
| |
| * Last Ether: Create the Last Ether and restore MP.
| |
| * Phoenix Soul: Create a Phoenix Soul, empowering allies with a second life. Effect: Auto Revive
| |
| * Almighty Shower: Create an Almighty Shower and wash away all status ailments.
| |
| * Security Dress: Create Security Dresses, preventing status ailments for 10 rounds.
| |
| * Smiling Moon: Create a Smiling Moon, absorbing all pleasure damage taken for 4 rounds.
| |
| * Shine Aura: Create a Shine Aura, regenerating HP/MP/SP for 10 rounds.
| |
| * Armor of Truth: Create sets of Armor of Truth, absorbing all elements except Holy, Dark, Pleasure, Bio, and Sonic for 4 rounds.
| |
